6-[5-[(2S)-5,7-dihydroxy-4-oxo-2,3-dihydrochromen-2-yl]-2,3-dihydroxyphenyl]-5,7-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one
| Internal ID | 1b65ad18-dd15-4373-b204-3e8fcc73dbd1 |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Biflavonoids and polyflavonoids |
| IUPAC Name | 6-[5-[(2S)-5,7-dihydroxy-4-oxo-2,3-dihydrochromen-2-yl]-2,3-dihydroxyphenyl]-5,7-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one |
| SMILES (Canonical) | C1C(OC2=CC(=CC(=C2C1=O)O)O)C3=CC(=C(C(=C3)O)O)C4=C(C5=C(C=C4O)OC(=CC5=O)C6=CC=C(C=C6)O)O |
| SMILES (Isomeric) | C1[C@H](OC2=CC(=CC(=C2C1=O)O)O)C3=CC(=C(C(=C3)O)O)C4=C(C5=C(C=C4O)OC(=CC5=O)C6=CC=C(C=C6)O)O |
| InChI | InChI=1S/C30H20O11/c31-14-3-1-12(2-4-14)22-10-20(36)28-25(40-22)11-18(34)26(30(28)39)16-5-13(6-21(37)29(16)38)23-9-19(35)27-17(33)7-15(32)8-24(27)41-23/h1-8,10-11,23,31-34,37-39H,9H2/t23-/m0/s1 |
| InChI Key | CXUZKWBMLDRVJW-QHCPKHFHSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C30H20O11 |
| Molecular Weight | 556.50 g/mol |
| Exact Mass | 556.10056145 g/mol |
| Topological Polar Surface Area (TPSA) | 194.00 Ų |
| XlogP | 4.40 |
| There are no found synonyms. |
![2D Structure of 6-[5-[(2S)-5,7-dihydroxy-4-oxo-2,3-dihydrochromen-2-yl]-2,3-dihydroxyphenyl]-5,7-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/5f00ef40-85c7-11ee-b80c-870ed648bbbf.jpg "2D Structure of 6-[5-[(2S)-5,7-dihydroxy-4-oxo-2,3-dihydrochromen-2-yl]-2,3-dihydroxyphenyl]-5,7-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.68% | 91.11% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 97.56% | 89.00% |
| CHEMBL3194 | P02766 | Transthyretin | 95.65% | 90.71% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 95.52% | 98.35% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 93.91% | 85.11% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 93.68% | 99.15% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.42% | 98.95% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.17% | 94.00% |
| CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 92.95% | 95.64% |
| CHEMBL1978 | P11511 | Cytochrome P450 19A1 | 92.82% | 91.76% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 92.60% | 96.21% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 92.54% | 95.78% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 92.38% | 99.23% |
| CHEMBL3038469 | P24941 | CDK2/Cyclin A | 91.68% | 91.38% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.37% | 97.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.35% | 85.14% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.85% | 95.56% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 88.72% | 90.71% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.60% | 94.45% |
| CHEMBL4630 | O14757 | Serine/threonine-protein kinase Chk1 | 87.96% | 97.03% |
| CHEMBL3438 | Q05513 | Protein kinase C zeta | 86.85% | 88.48% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 85.67% | 91.71% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.36% | 95.89% |
| CHEMBL1929 | P47989 | Xanthine dehydrogenase | 84.19% | 96.12% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.34% | 86.33% |
| CHEMBL2208 | P49137 | MAP kinase-activated protein kinase 2 | 82.11% | 95.20% |
| CHEMBL4530 | P00488 | Coagulation factor XIII | 81.89% | 96.00% |
| CHEMBL5284 | Q96RR4 | CaM-kinase kinase beta | 81.82% | 89.23% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.25% | 100.00% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 80.88% | 93.40% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 80.81% | 93.04% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Plagiomnium undulatum |
| PubChem | 162907847 |
| LOTUS | LTS0209543 |
| wikiData | Q104972152 |