[8-Acetyloxy-7-(1,3-benzodioxol-5-yl)-1,3-dimethoxy-6-methyl-5-prop-2-enyl-2-bicyclo[3.2.1]oct-3-enyl] acetate
Internal ID | 5570c228-962c-4f10-93f1-de7fdd5736cd |
Taxonomy | Organoheterocyclic compounds > Benzodioxoles |
IUPAC Name | [8-acetyloxy-7-(1,3-benzodioxol-5-yl)-1,3-dimethoxy-6-methyl-5-prop-2-enyl-2-bicyclo[3.2.1]oct-3-enyl] acetate |
SMILES (Canonical) | CC1C(C2(C(C(=CC1(C2OC(=O)C)CC=C)OC)OC(=O)C)OC)C3=CC4=C(C=C3)OCO4 |
SMILES (Isomeric) | CC1C(C2(C(C(=CC1(C2OC(=O)C)CC=C)OC)OC(=O)C)OC)C3=CC4=C(C=C3)OCO4 |
InChI | InChI=1S/C25H30O8/c1-7-10-24-12-20(28-5)22(32-15(3)26)25(29-6,23(24)33-16(4)27)21(14(24)2)17-8-9-18-19(11-17)31-13-30-18/h7-9,11-12,14,21-23H,1,10,13H2,2-6H3 |
InChI Key | CWNJRIFALHNITA-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C25H30O8 |
Molecular Weight | 458.50 g/mol |
Exact Mass | 458.19406791 g/mol |
Topological Polar Surface Area (TPSA) | 89.50 Ų |
XlogP | 3.30 |
There are no found synonyms. |
![2D Structure of [8-Acetyloxy-7-(1,3-benzodioxol-5-yl)-1,3-dimethoxy-6-methyl-5-prop-2-enyl-2-bicyclo[3.2.1]oct-3-enyl] acetate 2D Structure of [8-Acetyloxy-7-(1,3-benzodioxol-5-yl)-1,3-dimethoxy-6-methyl-5-prop-2-enyl-2-bicyclo[3.2.1]oct-3-enyl] acetate](https://plantaedb.com/storage/docs/compounds/2023/11/5efc8170-85fc-11ee-a9d8-c13c7a4ac0bc.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.19% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.67% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.51% | 94.45% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 95.00% | 96.77% |
CHEMBL240 | Q12809 | HERG | 91.00% | 89.76% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 90.88% | 96.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.06% | 97.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.40% | 89.00% |
CHEMBL2581 | P07339 | Cathepsin D | 88.59% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.45% | 86.33% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 88.35% | 92.62% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 88.21% | 91.19% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 87.02% | 95.89% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 86.64% | 94.80% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.81% | 96.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 85.70% | 90.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.75% | 100.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.58% | 95.56% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.56% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ocotea catharinensis |
PubChem | 162820315 |
LOTUS | LTS0230754 |
wikiData | Q103818116 |