[(2S,3R,4R,5S,6S)-6-methyl-2-[[(1S,3R,4S,5R,6R,8R,10S,22S,23S,24S,26R)-4,5,26-trihydroxy-6,24-dimethyl-20-oxo-10-pentyl-2,7,9,21,25-pentaoxatricyclo[20.3.1.03,8]hexacosan-23-yl]oxy]-4,5-bis[[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy]oxan-3-yl] (2S)-2-methylbutanoate
Internal ID | d2a4a323-4f43-4cf8-828f-84af9879e015 |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Oligosaccharides |
IUPAC Name | [(2S,3R,4R,5S,6S)-6-methyl-2-[[(1S,3R,4S,5R,6R,8R,10S,22S,23S,24S,26R)-4,5,26-trihydroxy-6,24-dimethyl-20-oxo-10-pentyl-2,7,9,21,25-pentaoxatricyclo[20.3.1.03,8]hexacosan-23-yl]oxy]-4,5-bis[[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy]oxan-3-yl] (2S)-2-methylbutanoate |
SMILES (Canonical) | CCCCCC1CCCCCCCCCC(=O)OC2C(C(OC(C2OC3C(C(C(C(O3)C)OC4C(C(C(C(O4)C)O)O)O)OC5C(C(C(C(O5)C)O)O)O)OC(=O)C(C)CC)C)OC6C(C(C(OC6O1)C)O)O)O |
SMILES (Isomeric) | CCCCC[C@H]1CCCCCCCCCC(=O)O[C@H]2[C@H]([C@@H](O[C@H]([C@@H]2O[C@H]3[C@@H]([C@@H]([C@H]([C@@H](O3)C)O[C@H]4[C@@H]([C@@H]([C@H]([C@@H](O4)C)O)O)O)O[C@H]5[C@@H]([C@@H]([C@H]([C@@H](O5)C)O)O)O)OC(=O)[C@@H](C)CC)C)O[C@@H]6[C@H]([C@H]([C@H](O[C@H]6O1)C)O)O)O |
InChI | InChI=1S/C51H88O23/c1-9-11-17-20-29-21-18-15-13-12-14-16-19-22-30(52)69-42-39(61)49(73-43-36(58)33(55)26(6)65-50(43)68-29)66-27(7)40(42)72-51-45(70-46(62)23(3)10-2)44(74-48-38(60)35(57)32(54)25(5)64-48)41(28(8)67-51)71-47-37(59)34(56)31(53)24(4)63-47/h23-29,31-45,47-51,53-61H,9-22H2,1-8H3/t23-,24-,25-,26+,27-,28-,29-,31-,32-,33-,34+,35+,36-,37+,38+,39+,40-,41-,42-,43+,44+,45+,47-,48-,49-,50-,51-/m0/s1 |
InChI Key | CLNVWQGPZSJHRG-WSPSWLHDSA-N |
Popularity | 0 references in papers |
Molecular Formula | C51H88O23 |
Molecular Weight | 1069.20 g/mol |
Exact Mass | 1068.57163905 g/mol |
Topological Polar Surface Area (TPSA) | 327.00 Ų |
XlogP | 2.50 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 99.13% | 98.95% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.97% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.39% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.43% | 91.11% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 93.32% | 100.00% |
CHEMBL4462 | Q8IXJ6 | NAD-dependent deacetylase sirtuin 2 | 92.85% | 90.24% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 92.27% | 92.62% |
CHEMBL4072 | P07858 | Cathepsin B | 91.96% | 93.67% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 91.38% | 93.56% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 91.32% | 92.50% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 90.50% | 90.71% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.18% | 89.00% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 88.65% | 96.47% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 87.45% | 83.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.35% | 99.17% |
CHEMBL1968 | P07099 | Epoxide hydrolase 1 | 86.65% | 98.57% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.13% | 95.89% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.41% | 97.09% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.32% | 91.19% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 84.17% | 94.33% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 83.65% | 96.61% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.57% | 86.33% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 83.53% | 96.38% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 82.00% | 97.36% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 81.72% | 96.77% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.67% | 95.56% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.01% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ipomoea batatas |
PubChem | 162943877 |
LOTUS | LTS0033862 |
wikiData | Q104963695 |