2,9,10-Trihydroxy-4,6,12,17,17-pentamethyl-18-(3,4,5-trihydroxyoxan-2-yl)oxyhexacyclo[11.9.0.01,21.04,12.05,10.016,21]docos-13-en-8-one
| Internal ID | ea81ce1e-83cf-4071-b35e-cb2f6088b11a |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides |
| IUPAC Name | 2,9,10-trihydroxy-4,6,12,17,17-pentamethyl-18-(3,4,5-trihydroxyoxan-2-yl)oxyhexacyclo[11.9.0.01,21.04,12.05,10.016,21]docos-13-en-8-one |
| SMILES (Canonical) | CC1CC(=O)C(C2(C1C3(CC(C45CC46CCC(C(C6CC=C5C3(C2)C)(C)C)OC7C(C(C(CO7)O)O)O)O)C)O)O |
| SMILES (Isomeric) | CC1CC(=O)C(C2(C1C3(CC(C45CC46CCC(C(C6CC=C5C3(C2)C)(C)C)OC7C(C(C(CO7)O)O)O)O)C)O)O |
| InChI | InChI=1S/C32H48O9/c1-15-10-16(33)25(38)32(39)13-29(5)19-7-6-18-27(2,3)21(41-26-23(37)22(36)17(34)12-40-26)8-9-30(18)14-31(19,30)20(35)11-28(29,4)24(15)32/h7,15,17-18,20-26,34-39H,6,8-14H2,1-5H3 |
| InChI Key | XAOFACFLIBLCBM-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C32H48O9 |
| Molecular Weight | 576.70 g/mol |
| Exact Mass | 576.32983310 g/mol |
| Topological Polar Surface Area (TPSA) | 157.00 Ų |
| XlogP | 0.80 |
| There are no found synonyms. |
![2D Structure of 2,9,10-Trihydroxy-4,6,12,17,17-pentamethyl-18-(3,4,5-trihydroxyoxan-2-yl)oxyhexacyclo[11.9.0.01,21.04,12.05,10.016,21]docos-13-en-8-one](https://plantaedb.com/storage/docs/compounds/2023/11/5ec9f520-85ea-11ee-97b3-092c889a1841.jpg "2D Structure of 2,9,10-Trihydroxy-4,6,12,17,17-pentamethyl-18-(3,4,5-trihydroxyoxan-2-yl)oxyhexacyclo[11.9.0.01,21.04,12.05,10.016,21]docos-13-en-8-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.72% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.42% | 91.11% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.35% | 97.25% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.35% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.91% | 95.56% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 91.31% | 96.77% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 91.01% | 100.00% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 89.68% | 92.94% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.19% | 89.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.24% | 97.09% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.16% | 94.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.70% | 86.33% |
| CHEMBL1871 | P10275 | Androgen Receptor | 85.68% | 96.43% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 85.40% | 91.07% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 83.80% | 94.75% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 81.07% | 82.69% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.03% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Actaea cimicifuga |
| Actaea simplex |
| PubChem | 85090709 |
| LOTUS | LTS0129741 |
| wikiData | Q105324016 |