4-(Hydroxymethyl)-9-[3-[[5-(hydroxymethyl)-1,4-dimethyl-2,5-bis(methylsulfanyl)-3,6-dioxopiperazin-2-yl]methyl]indol-1-yl]-5-methyl-4,7-bis(methylsulfanyl)-2,5,16-triazatetracyclo[7.7.0.02,7.010,15]hexadeca-10,12,14-triene-3,6-dione
| Internal ID | 57673ceb-eaf5-4b52-9bf5-72a13d101ccf |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Pyrroloindoles |
| IUPAC Name | 4-(hydroxymethyl)-9-[3-[[5-(hydroxymethyl)-1,4-dimethyl-2,5-bis(methylsulfanyl)-3,6-dioxopiperazin-2-yl]methyl]indol-1-yl]-5-methyl-4,7-bis(methylsulfanyl)-2,5,16-triazatetracyclo[7.7.0.02,7.010,15]hexadeca-10,12,14-triene-3,6-dione |
| SMILES (Canonical) | CN1C(=O)C(N(C(=O)C1(CC2=CN(C3=CC=CC=C32)C45CC6(C(=O)N(C(C(=O)N6C4NC7=CC=CC=C57)(CO)SC)C)SC)SC)C)(CO)SC |
| SMILES (Isomeric) | CN1C(=O)C(N(C(=O)C1(CC2=CN(C3=CC=CC=C32)C45CC6(C(=O)N(C(C(=O)N6C4NC7=CC=CC=C57)(CO)SC)C)SC)SC)C)(CO)SC |
| InChI | InChI=1S/C35H42N6O6S4/c1-37-29(46)34(19-42,50-6)38(2)27(44)32(37,48-4)16-21-17-40(25-15-11-8-12-22(21)25)31-18-33(49-5)28(45)39(3)35(20-43,51-7)30(47)41(33)26(31)36-24-14-10-9-13-23(24)31/h8-15,17,26,36,42-43H,16,18-20H2,1-7H3 |
| InChI Key | YDUJBQZOCBSEQA-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C35H42N6O6S4 |
| Molecular Weight | 771.00 g/mol |
| Exact Mass | 770.20486777 g/mol |
| Topological Polar Surface Area (TPSA) | 240.00 Ų |
| XlogP | 3.60 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 98.96% | 98.95% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 98.79% | 94.75% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 97.84% | 95.56% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 97.41% | 90.08% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.37% | 96.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.34% | 85.14% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 95.80% | 93.99% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.66% | 97.25% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 92.40% | 92.97% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.51% | 91.11% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 90.14% | 88.56% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 89.57% | 98.03% |
| CHEMBL325 | Q13547 | Histone deacetylase 1 | 89.14% | 95.92% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.40% | 99.23% |
| CHEMBL202 | P00374 | Dihydrofolate reductase | 87.31% | 89.92% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.22% | 89.00% |
| CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 86.52% | 85.49% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 85.85% | 82.69% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 84.49% | 90.00% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 82.82% | 98.59% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.70% | 86.33% |
| CHEMBL228 | P31645 | Serotonin transporter | 81.39% | 95.51% |
| CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 81.22% | 96.37% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 80.68% | 95.83% |
| CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 80.13% | 96.25% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 73224143 |
| LOTUS | LTS0136292 |
| wikiData | Q105347038 |