Bis[2-hydroxy-3-[3-(4-hydroxyphenyl)prop-2-enoyloxy]propyl] 2,4-bis(4-hydroxyphenyl)cyclobutane-1,3-dicarboxylate
| Internal ID | 58431f55-c6d8-4828-be71-8d97b148c3da |
| Taxonomy | Phenylpropanoids and polyketides > Cinnamic acids and derivatives > Hydroxycinnamic acids and derivatives > Hydroxycinnamic acid esters > Coumaric acid esters |
| IUPAC Name | bis[2-hydroxy-3-[3-(4-hydroxyphenyl)prop-2-enoyloxy]propyl] 2,4-bis(4-hydroxyphenyl)cyclobutane-1,3-dicarboxylate |
| SMILES (Canonical) | C1=CC(=CC=C1C=CC(=O)OCC(COC(=O)C2C(C(C2C3=CC=C(C=C3)O)C(=O)OCC(COC(=O)C=CC4=CC=C(C=C4)O)O)C5=CC=C(C=C5)O)O)O |
| SMILES (Isomeric) | C1=CC(=CC=C1C=CC(=O)OCC(COC(=O)C2C(C(C2C3=CC=C(C=C3)O)C(=O)OCC(COC(=O)C=CC4=CC=C(C=C4)O)O)C5=CC=C(C=C5)O)O)O |
| InChI | InChI=1S/C42H40O14/c43-29-11-1-25(2-12-29)5-19-35(49)53-21-33(47)23-55-41(51)39-37(27-7-15-31(45)16-8-27)40(38(39)28-9-17-32(46)18-10-28)42(52)56-24-34(48)22-54-36(50)20-6-26-3-13-30(44)14-4-26/h1-20,33-34,37-40,43-48H,21-24H2 |
| InChI Key | OVNMUAZKKIXMSH-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C42H40O14 |
| Molecular Weight | 768.80 g/mol |
| Exact Mass | 768.24180595 g/mol |
| Topological Polar Surface Area (TPSA) | 227.00 Ų |
| XlogP | 4.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.04% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.78% | 96.09% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.21% | 97.09% |
| CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 91.41% | 89.67% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.97% | 94.45% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 89.90% | 96.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.36% | 86.33% |
| CHEMBL3194 | P02766 | Transthyretin | 87.91% | 90.71% |
| CHEMBL301 | P24941 | Cyclin-dependent kinase 2 | 87.90% | 91.23% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.48% | 99.17% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.46% | 89.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.48% | 95.56% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 82.44% | 91.71% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 81.94% | 97.21% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 81.55% | 98.35% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.30% | 100.00% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 80.90% | 91.49% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162849579 |
| LOTUS | LTS0021089 |
| wikiData | Q105200884 |