(3S,5S,8R,9S,10S,13R,14R,17S)-17-[(2S,5S)-2,5-dihydroxy-6-methyl-1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhept-6-en-2-yl]-3-[(2S,3R,4S,5S)-5-hydroxy-3-[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy-4-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-4,4,8,14-tetramethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-10-carbaldehyde
Internal ID | f020be29-467b-45dc-9991-83488a87d729 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Triterpene glycosides > Triterpene saponins |
IUPAC Name | (3S,5S,8R,9S,10S,13R,14R,17S)-17-[(2S,5S)-2,5-dihydroxy-6-methyl-1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhept-6-en-2-yl]-3-[(2S,3R,4S,5S)-5-hydroxy-3-[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy-4-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-4,4,8,14-tetramethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-10-carbaldehyde |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(C(COC2OC3CCC4(C5CCC6C(CCC6(C5(CCC4C3(C)C)C)C)C(CCC(C(=C)C)O)(COC7C(C(C(C(O7)CO)O)O)O)O)C=O)O)OC8C(C(C(CO8)O)O)O)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@H](O1)O[C@@H]2[C@H]([C@H](CO[C@H]2O[C@H]3CC[C@@]4([C@H]5CC[C@@H]6[C@H](CC[C@]6([C@@]5(CC[C@H]4C3(C)C)C)C)[C@@](CC[C@@H](C(=C)C)O)(CO[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O)O)O)O)C=O)O)O[C@H]8[C@@H]([C@H]([C@@H](CO8)O)O)O)O)O)O |
InChI | InChI=1S/C52H86O22/c1-23(2)27(55)11-17-52(66,22-69-45-40(64)38(62)36(60)30(18-53)71-45)26-10-14-49(6)25(26)8-9-32-50(49,7)15-12-31-48(4,5)33(13-16-51(31,32)21-54)72-47-43(74-46-41(65)37(61)34(58)24(3)70-46)42(29(57)20-68-47)73-44-39(63)35(59)28(56)19-67-44/h21,24-47,53,55-66H,1,8-20,22H2,2-7H3/t24-,25+,26-,27-,28+,29-,30+,31-,32-,33-,34-,35-,36+,37+,38-,39+,40+,41+,42-,43+,44-,45+,46+,47-,49+,50+,51+,52+/m0/s1 |
InChI Key | PPUWTMMPCPRUMR-WJGZZZSTSA-N |
Popularity | 0 references in papers |
Molecular Formula | C52H86O22 |
Molecular Weight | 1063.20 g/mol |
Exact Mass | 1062.56107437 g/mol |
Topological Polar Surface Area (TPSA) | 354.00 Ų |
XlogP | -0.60 |
There are no found synonyms. |
![2D Structure of (3S,5S,8R,9S,10S,13R,14R,17S)-17-[(2S,5S)-2,5-dihydroxy-6-methyl-1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhept-6-en-2-yl]-3-[(2S,3R,4S,5S)-5-hydroxy-3-[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy-4-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-4,4,8,14-tetramethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-10-carbaldehyde 2D Structure of (3S,5S,8R,9S,10S,13R,14R,17S)-17-[(2S,5S)-2,5-dihydroxy-6-methyl-1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhept-6-en-2-yl]-3-[(2S,3R,4S,5S)-5-hydroxy-3-[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy-4-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-4,4,8,14-tetramethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-10-carbaldehyde](https://plantaedb.com/storage/docs/compounds/2023/11/5dd7e980-8561-11ee-8042-0d19ad9ade93.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.47% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.77% | 96.09% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 96.16% | 96.61% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.81% | 97.25% |
CHEMBL233 | P35372 | Mu opioid receptor | 93.26% | 97.93% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 93.02% | 91.49% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.80% | 97.09% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 92.27% | 91.24% |
CHEMBL2581 | P07339 | Cathepsin D | 90.99% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.62% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.65% | 86.33% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 87.45% | 95.89% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 87.20% | 92.88% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 87.12% | 92.94% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 86.98% | 100.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.98% | 95.56% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 86.85% | 97.36% |
CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR | 86.59% | 92.78% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.46% | 100.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.45% | 95.89% |
CHEMBL325 | Q13547 | Histone deacetylase 1 | 86.44% | 95.92% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 85.54% | 97.14% |
CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 84.77% | 85.31% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 84.36% | 92.86% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 83.81% | 97.29% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 83.63% | 95.71% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.51% | 99.17% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.27% | 94.45% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.73% | 100.00% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 81.57% | 98.75% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 80.84% | 94.75% |
CHEMBL2243 | O00519 | Anandamide amidohydrolase | 80.72% | 97.53% |
CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 80.36% | 95.71% |
CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 80.08% | 97.86% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Gynostemma pentaphyllum |
PubChem | 162960953 |
LOTUS | LTS0093707 |
wikiData | Q105213053 |