[(1R,4aR)-5-hydroxy-1,4a-dimethyl-6-oxo-7-propan-2-yl-3,4-dihydro-2H-phenanthren-1-yl]methyl 4-hydroxybenzoate
| Internal ID | e8435985-2f95-4163-be5b-704c38c81aa1 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
| IUPAC Name | [(1R,4aR)-5-hydroxy-1,4a-dimethyl-6-oxo-7-propan-2-yl-3,4-dihydro-2H-phenanthren-1-yl]methyl 4-hydroxybenzoate |
| SMILES (Canonical) | CC(C)C1=CC2=CC=C3C(CCCC3(C2=C(C1=O)O)C)(C)COC(=O)C4=CC=C(C=C4)O |
| SMILES (Isomeric) | CC(C)C1=CC2=CC=C3[C@](CCC[C@]3(C2=C(C1=O)O)C)(C)COC(=O)C4=CC=C(C=C4)O |
| InChI | InChI=1S/C27H30O5/c1-16(2)20-14-18-8-11-21-26(3,15-32-25(31)17-6-9-19(28)10-7-17)12-5-13-27(21,4)22(18)24(30)23(20)29/h6-11,14,16,28,30H,5,12-13,15H2,1-4H3/t26-,27+/m0/s1 |
| InChI Key | HPEFOINJABTGSR-RRPNLBNLSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C27H30O5 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.20932405 g/mol |
| Topological Polar Surface Area (TPSA) | 83.80 Ų |
| XlogP | 5.40 |
| There are no found synonyms. |
![2D Structure of [(1R,4aR)-5-hydroxy-1,4a-dimethyl-6-oxo-7-propan-2-yl-3,4-dihydro-2H-phenanthren-1-yl]methyl 4-hydroxybenzoate](https://plantaedb.com/storage/docs/compounds/2023/11/5da41ab0-8712-11ee-87bf-9d5cb1af8cf2.jpg "2D Structure of [(1R,4aR)-5-hydroxy-1,4a-dimethyl-6-oxo-7-propan-2-yl-3,4-dihydro-2H-phenanthren-1-yl]methyl 4-hydroxybenzoate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 96.24% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.20% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.23% | 94.45% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.88% | 97.25% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.96% | 96.09% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 87.85% | 90.71% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.87% | 99.23% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 85.53% | 93.10% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.74% | 86.33% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.10% | 95.56% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 83.51% | 91.07% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 82.73% | 94.75% |
| CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 82.69% | 85.31% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.65% | 97.09% |
| CHEMBL2535 | P11166 | Glucose transporter | 82.20% | 98.75% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 80.90% | 100.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 80.19% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Plectranthus strigosus |
| PubChem | 162934994 |
| LOTUS | LTS0203393 |
| wikiData | Q105031669 |