9-Methoxy-4-prop-2-enyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-ol
| Internal ID | 1445950d-8a6c-48aa-89a4-bc897b018e34 |
| Taxonomy | Alkaloids and derivatives > Amaryllidaceae alkaloids > Galanthamine-type amaryllidaceae alkaloids |
| IUPAC Name | 9-methoxy-4-prop-2-enyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-ol |
| SMILES (Canonical) | COC1=C2C3=C(CN(CCC34C=CC(CC4O2)O)CC=C)C=C1 |
| SMILES (Isomeric) | COC1=C2C3=C(CN(CCC34C=CC(CC4O2)O)CC=C)C=C1 |
| InChI | InChI=1S/C19H23NO3/c1-3-9-20-10-8-19-7-6-14(21)11-16(19)23-18-15(22-2)5-4-13(12-20)17(18)19/h3-7,14,16,21H,1,8-12H2,2H3 |
| InChI Key | BQESVZIPHFRYNG-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.16779360 g/mol |
| Topological Polar Surface Area (TPSA) | 41.90 Ų |
| XlogP | 2.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.04% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.78% | 86.33% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 91.31% | 89.62% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 90.10% | 93.99% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.73% | 94.45% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 89.57% | 97.25% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.52% | 95.89% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 86.83% | 90.24% |
| CHEMBL240 | Q12809 | HERG | 86.52% | 89.76% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 85.54% | 91.03% |
| CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 85.44% | 96.25% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.42% | 95.56% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.85% | 94.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 82.12% | 91.11% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.28% | 97.09% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.24% | 97.14% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.08% | 100.00% |
| CHEMBL4829 | O00763 | Acetyl-CoA carboxylase 2 | 80.45% | 98.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Leucojum aestivum |
| PubChem | 13892266 |
| LOTUS | LTS0205280 |
| wikiData | Q104944304 |