3-[4-hydroxy-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]propanoic acid
Internal ID | fa14d4a9-9abb-4499-8b6f-6c5bc4a2b52e |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > Phenolic glycosides |
IUPAC Name | 3-[4-hydroxy-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]propanoic acid |
SMILES (Canonical) | C1=CC(=C(C=C1O)OC2C(C(C(C(O2)CO)O)O)O)CCC(=O)O |
SMILES (Isomeric) | C1=CC(=C(C=C1O)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O)CCC(=O)O |
InChI | InChI=1S/C15H20O9/c16-6-10-12(20)13(21)14(22)15(24-10)23-9-5-8(17)3-1-7(9)2-4-11(18)19/h1,3,5,10,12-17,20-22H,2,4,6H2,(H,18,19)/t10-,12-,13+,14-,15-/m1/s1 |
InChI Key | ZOXGFRPOVZICLP-TVKJYDDYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C15H20O9 |
Molecular Weight | 344.31 g/mol |
Exact Mass | 344.11073221 g/mol |
Topological Polar Surface Area (TPSA) | 157.00 Ų |
XlogP | -1.10 |
2-(?-D-Glucopyranosyloxy)-4-hydroxybenzenepropanoi |
663627-25-6 |
![2D Structure of 3-[4-hydroxy-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]propanoic acid 2D Structure of 3-[4-hydroxy-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]propanoic acid](https://plantaedb.com/storage/docs/compounds/2023/11/5d478e60-8603-11ee-bcff-43e41dde2009.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.44% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.93% | 96.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.82% | 99.17% |
CHEMBL2581 | P07339 | Cathepsin D | 94.54% | 98.95% |
CHEMBL220 | P22303 | Acetylcholinesterase | 93.67% | 94.45% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.56% | 86.33% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 87.61% | 95.89% |
CHEMBL3401 | O75469 | Pregnane X receptor | 85.42% | 94.73% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 85.22% | 99.15% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 83.85% | 94.62% |
CHEMBL3194 | P02766 | Transthyretin | 83.43% | 90.71% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 83.08% | 97.36% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.08% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.48% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Peucedanum japonicum |
PubChem | 11427899 |
LOTUS | LTS0240667 |
wikiData | Q105380761 |