[3,4,5-Trihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl] 2-phenylpropanoate
Internal ID | 534d044d-6185-4b1e-92bc-a772bb1d58d3 |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > O-glycosyl compounds |
IUPAC Name | [3,4,5-trihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl] 2-phenylpropanoate |
SMILES (Canonical) | CC(C1=CC=CC=C1)C(=O)OC2C(C(C(C(O2)COC3C(C(C(C(O3)CO)O)O)O)O)O)O |
SMILES (Isomeric) | CC(C1=CC=CC=C1)C(=O)OC2C(C(C(C(O2)COC3C(C(C(C(O3)CO)O)O)O)O)O)O |
InChI | InChI=1S/C21H30O12/c1-9(10-5-3-2-4-6-10)19(29)33-21-18(28)16(26)14(24)12(32-21)8-30-20-17(27)15(25)13(23)11(7-22)31-20/h2-6,9,11-18,20-28H,7-8H2,1H3 |
InChI Key | LLUWQGLSKQISDM-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H30O12 |
Molecular Weight | 474.50 g/mol |
Exact Mass | 474.17372639 g/mol |
Topological Polar Surface Area (TPSA) | 196.00 Ų |
XlogP | -2.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.49% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 95.97% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.97% | 91.11% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 92.45% | 90.17% |
CHEMBL3401 | O75469 | Pregnane X receptor | 91.20% | 94.73% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 90.67% | 94.62% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 89.53% | 96.00% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 89.19% | 94.08% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 88.36% | 94.23% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.87% | 95.56% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.91% | 99.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.01% | 86.33% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 83.08% | 96.47% |
CHEMBL5028 | O14672 | ADAM10 | 82.33% | 97.50% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 80.49% | 95.93% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Nicotiana tabacum |
PubChem | 162910866 |
LOTUS | LTS0224630 |
wikiData | Q105153746 |