[(2R,3S,5S)-2,3,4,5-tetrahydroxy-6-[[(2S,3S,5S)-2,3,4-trihydroxy-6-(hydroxymethyl)-5-[(3S,4S,5S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxymethyl]oxan-2-yl] (1R,3aS,5aR,5bR,7aR,9R,11aR,11bR,13aR,13bR)-1-but-1-en-2-yl-9-hydroperoxy-5a,5b,8,8,11a-pentamethyl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carboxylate
| Internal ID | ce18efcf-7fee-471e-b461-3de5867242b6 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Triterpene glycosides > Triterpene saponins |
| IUPAC Name | [(2R,3S,5S)-2,3,4,5-tetrahydroxy-6-[[(2S,3S,5S)-2,3,4-trihydroxy-6-(hydroxymethyl)-5-[(3S,4S,5S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxymethyl]oxan-2-yl] (1R,3aS,5aR,5bR,7aR,9R,11aR,11bR,13aR,13bR)-1-but-1-en-2-yl-9-hydroperoxy-5a,5b,8,8,11a-pentamethyl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carboxylate |
| SMILES (Canonical) | CCC(=C)C1CCC2(C1C3CCC4C5(CCC(C(C5CCC4(C3(CC2)C)C)(C)C)OO)C)C(=O)OC6(C(C(C(C(O6)COC7(C(C(C(C(O7)CO)OC8C(C(C(C(O8)C)O)O)O)O)O)O)O)O)O)O |
| SMILES (Isomeric) | CCC(=C)[C@@H]1CC[C@]2([C@H]1[C@H]3CC[C@@H]4[C@]5(CC[C@H](C([C@@H]5CC[C@]4([C@@]3(CC2)C)C)(C)C)OO)C)C(=O)O[C@]6([C@H](C([C@@H](C(O6)CO[C@]7([C@H](C([C@@H](C(O7)CO)OC8[C@H]([C@H]([C@@H]([C@H](O8)C)O)O)O)O)O)O)O)O)O)O |
| InChI | InChI=1S/C49H80O20/c1-9-22(2)24-12-17-47(19-18-45(7)25(31(24)47)10-11-29-44(6)15-14-30(69-62)43(4,5)28(44)13-16-46(29,45)8)42(59)68-49(61)39(57)35(54)33(52)27(67-49)21-63-48(60)40(58)37(56)38(26(20-50)66-48)65-41-36(55)34(53)32(51)23(3)64-41/h23-41,50-58,60-62H,2,9-21H2,1,3-8H3/t23-,24+,25-,26?,27?,28+,29-,30-,31-,32-,33-,34+,35?,36+,37?,38-,39+,40+,41?,44+,45-,46-,47+,48+,49-/m1/s1 |
| InChI Key | ITNGAGQTULAZRA-STBLJEOWSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C49H80O20 |
| Molecular Weight | 989.10 g/mol |
| Exact Mass | 988.52429494 g/mol |
| Topological Polar Surface Area (TPSA) | 324.00 Ų |
| XlogP | 2.10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.90% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.01% | 91.11% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 94.04% | 92.94% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.81% | 98.95% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 93.72% | 96.61% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 93.38% | 95.93% |
| CHEMBL233 | P35372 | Mu opioid receptor | 92.31% | 97.93% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.81% | 97.09% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 89.12% | 91.24% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.91% | 94.45% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.72% | 100.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.17% | 94.00% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 86.93% | 95.50% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.82% | 95.89% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.69% | 89.00% |
| CHEMBL4072 | P07858 | Cathepsin B | 84.34% | 93.67% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.14% | 95.56% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 83.98% | 95.83% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.87% | 86.33% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 83.79% | 97.25% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 83.43% | 97.36% |
| CHEMBL2243 | O00519 | Anandamide amidohydrolase | 83.41% | 97.53% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 83.31% | 100.00% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.32% | 95.89% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 82.15% | 92.50% |
| CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 81.47% | 100.00% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 81.13% | 96.77% |
| CHEMBL5028 | O14672 | ADAM10 | 80.79% | 97.50% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 80.62% | 92.86% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162817478 |
| LOTUS | LTS0049606 |
| wikiData | Q105120156 |