(3aR,4S,5S,6'S,7aS)-6'-hydroxy-5,6',7a-trimethyl-3-propan-2-ylspiro[3a,5,6,7-tetrahydroindene-4,3'-cyclohexene]-1-one
| Internal ID | 1fb5b034-c066-4801-959f-10d525d12e0a |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
| IUPAC Name | (3aR,4S,5S,6'S,7aS)-6'-hydroxy-5,6',7a-trimethyl-3-propan-2-ylspiro[3a,5,6,7-tetrahydroindene-4,3'-cyclohexene]-1-one |
| SMILES (Canonical) | CC1CCC2(C(C13CCC(C=C3)(C)O)C(=CC2=O)C(C)C)C |
| SMILES (Isomeric) | C[C@H]1CC[C@]2([C@@H]([C@@]13CC[C@](C=C3)(C)O)C(=CC2=O)C(C)C)C |
| InChI | InChI=1S/C20H30O2/c1-13(2)15-12-16(21)19(5)7-6-14(3)20(17(15)19)10-8-18(4,22)9-11-20/h8,10,12-14,17,22H,6-7,9,11H2,1-5H3/t14-,17-,18+,19+,20-/m0/s1 |
| InChI Key | DHFSZFPDRAAZAV-YLLORCDKSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.50 g/mol |
| Exact Mass | 302.224580195 g/mol |
| Topological Polar Surface Area (TPSA) | 37.30 Ų |
| XlogP | 3.60 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 95.56% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.84% | 91.11% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.76% | 97.25% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.31% | 96.09% |
| CHEMBL4072 | P07858 | Cathepsin B | 90.97% | 93.67% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 89.11% | 94.80% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.68% | 100.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.93% | 95.56% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 87.58% | 82.69% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 86.55% | 96.77% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.03% | 95.89% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.71% | 89.00% |
| CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 83.44% | 86.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.21% | 94.45% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.63% | 99.23% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 80.82% | 85.14% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 80.67% | 94.75% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.58% | 90.71% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.55% | 97.09% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 80.10% | 90.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 11185737 |
| LOTUS | LTS0132819 |
| wikiData | Q104979987 |