17-hydroxy-N-[2-[5-[3,4,5-trihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxy-1H-indol-3-yl]ethyl]octadecanamide
Internal ID | ccf63f95-119d-4938-ab85-66cd2e66d092 |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > Phenolic glycosides |
IUPAC Name | 17-hydroxy-N-[2-[5-[3,4,5-trihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxy-1H-indol-3-yl]ethyl]octadecanamide |
SMILES (Canonical) | CC(CCCCCCCCCCCCCCCC(=O)NCCC1=CNC2=C1C=C(C=C2)OC3C(C(C(C(O3)COC4C(C(C(C(O4)CO)O)O)O)O)O)O)O |
SMILES (Isomeric) | CC(CCCCCCCCCCCCCCCC(=O)NCCC1=CNC2=C1C=C(C=C2)OC3C(C(C(C(O3)COC4C(C(C(C(O4)CO)O)O)O)O)O)O)O |
InChI | InChI=1S/C40H66N2O13/c1-25(44)15-13-11-9-7-5-3-2-4-6-8-10-12-14-16-32(45)41-20-19-26-22-42-29-18-17-27(21-28(26)29)53-40-38(51)36(49)34(47)31(55-40)24-52-39-37(50)35(48)33(46)30(23-43)54-39/h17-18,21-22,25,30-31,33-40,42-44,46-51H,2-16,19-20,23-24H2,1H3,(H,41,45) |
InChI Key | RDRLCTWXJMMJDI-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C40H66N2O13 |
Molecular Weight | 783.00 g/mol |
Exact Mass | 782.45649016 g/mol |
Topological Polar Surface Area (TPSA) | 244.00 Ų |
XlogP | 4.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.86% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 98.66% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.48% | 96.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 97.37% | 99.17% |
CHEMBL220 | P22303 | Acetylcholinesterase | 95.61% | 94.45% |
CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 93.83% | 94.00% |
CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 93.81% | 85.31% |
CHEMBL3401 | O75469 | Pregnane X receptor | 93.73% | 94.73% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 93.65% | 94.75% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.45% | 97.09% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 92.55% | 97.79% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 91.20% | 96.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.90% | 89.00% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 88.48% | 93.18% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.20% | 94.45% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 87.08% | 95.00% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 87.04% | 89.62% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 85.76% | 92.88% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.72% | 99.23% |
CHEMBL255 | P29275 | Adenosine A2b receptor | 83.17% | 98.59% |
CHEMBL2535 | P11166 | Glucose transporter | 82.20% | 98.75% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.77% | 94.33% |
CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 81.02% | 95.56% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.53% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Withania somnifera |
PubChem | 76641673 |
LOTUS | LTS0166236 |
wikiData | Q105234415 |