(8-Acetyloxy-3-ethenyl-3,4a,7,7,10a-pentamethyl-5-oxo-1,2,6,6a,8,9,10,10b-octahydrobenzo[f]chromen-10-yl) 2-methylbut-2-enoate
Internal ID | d2be61f9-1bc9-4b57-8247-503a9fc8ddbc |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | (8-acetyloxy-3-ethenyl-3,4a,7,7,10a-pentamethyl-5-oxo-1,2,6,6a,8,9,10,10b-octahydrobenzo[f]chromen-10-yl) 2-methylbut-2-enoate |
SMILES (Canonical) | CC=C(C)C(=O)OC1CC(C(C2C1(C3CCC(OC3(C(=O)C2)C)(C)C=C)C)(C)C)OC(=O)C |
SMILES (Isomeric) | CC=C(C)C(=O)OC1CC(C(C2C1(C3CCC(OC3(C(=O)C2)C)(C)C=C)C)(C)C)OC(=O)C |
InChI | InChI=1S/C27H40O6/c1-10-16(3)23(30)32-22-15-21(31-17(4)28)24(5,6)19-14-20(29)27(9)18(26(19,22)8)12-13-25(7,11-2)33-27/h10-11,18-19,21-22H,2,12-15H2,1,3-9H3 |
InChI Key | HXIYGSKVKLNHSK-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C27H40O6 |
Molecular Weight | 460.60 g/mol |
Exact Mass | 460.28248899 g/mol |
Topological Polar Surface Area (TPSA) | 78.90 Ų |
XlogP | 4.80 |
There are no found synonyms. |
![2D Structure of (8-Acetyloxy-3-ethenyl-3,4a,7,7,10a-pentamethyl-5-oxo-1,2,6,6a,8,9,10,10b-octahydrobenzo[f]chromen-10-yl) 2-methylbut-2-enoate 2D Structure of (8-Acetyloxy-3-ethenyl-3,4a,7,7,10a-pentamethyl-5-oxo-1,2,6,6a,8,9,10,10b-octahydrobenzo[f]chromen-10-yl) 2-methylbut-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/5ca67640-850a-11ee-a22a-c9c77358b380.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.92% | 91.11% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 92.24% | 94.75% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 92.21% | 91.19% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 91.68% | 92.94% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.51% | 99.23% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 88.90% | 82.69% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.40% | 97.09% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.33% | 96.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.42% | 89.00% |
CHEMBL1907601 | P11802 | Cyclin-dependent kinase 4/cyclin D1 | 86.24% | 98.99% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 85.63% | 92.62% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.21% | 86.33% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 84.60% | 93.04% |
CHEMBL2581 | P07339 | Cathepsin D | 84.26% | 98.95% |
CHEMBL5408 | Q9UHD2 | Serine/threonine-protein kinase TBK1 | 82.17% | 90.48% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.99% | 94.00% |
CHEMBL325 | Q13547 | Histone deacetylase 1 | 81.37% | 95.92% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.97% | 95.56% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.61% | 100.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.60% | 95.89% |
CHEMBL3524 | P56524 | Histone deacetylase 4 | 80.38% | 92.97% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Helichrysum ambiguum |
PubChem | 162995211 |
LOTUS | LTS0078137 |
wikiData | Q105035032 |