methyl (1S,4aS,5S,6R,7S,7aR)-6-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-5-hydroxy-7-methyl-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate
Internal ID | 659d26d0-f5ec-4731-af67-f264c7889437 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Iridoid O-glycosides |
IUPAC Name | methyl (1S,4aS,5S,6R,7S,7aR)-6-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-5-hydroxy-7-methyl-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate |
SMILES (Canonical) | CC1C2C(C(C1OC(=O)C=CC3=CC(=C(C=C3)O)O)O)C(=COC2OC4C(C(C(C(O4)CO)O)O)O)C(=O)OC |
SMILES (Isomeric) | C[C@H]1[C@@H]2[C@H]([C@@H]([C@@H]1OC(=O)/C=C/C3=CC(=C(C=C3)O)O)O)C(=CO[C@H]2O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)C(=O)OC |
InChI | InChI=1S/C26H32O14/c1-10-17-18(20(32)23(10)39-16(30)6-4-11-3-5-13(28)14(29)7-11)12(24(35)36-2)9-37-25(17)40-26-22(34)21(33)19(31)15(8-27)38-26/h3-7,9-10,15,17-23,25-29,31-34H,8H2,1-2H3/b6-4+/t10-,15+,17+,18+,19+,20-,21-,22+,23+,25-,26-/m0/s1 |
InChI Key | LMYIPCDGVFQAHU-JLTSQMGESA-N |
Popularity | 0 references in papers |
Molecular Formula | C26H32O14 |
Molecular Weight | 568.50 g/mol |
Exact Mass | 568.17920569 g/mol |
Topological Polar Surface Area (TPSA) | 222.00 Ų |
XlogP | -0.40 |
There are no found synonyms. |
![2D Structure of methyl (1S,4aS,5S,6R,7S,7aR)-6-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-5-hydroxy-7-methyl-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate 2D Structure of methyl (1S,4aS,5S,6R,7S,7aR)-6-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-5-hydroxy-7-methyl-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate](https://plantaedb.com/storage/docs/compounds/2023/11/5c37d3e0-858b-11ee-a4cd-cd5f87abbfd2.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.67% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 96.53% | 86.33% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 96.49% | 91.49% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 94.74% | 96.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.58% | 96.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.96% | 89.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 92.08% | 94.73% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.55% | 99.17% |
CHEMBL4208 | P20618 | Proteasome component C5 | 87.71% | 90.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.97% | 95.56% |
CHEMBL3194 | P02766 | Transthyretin | 82.13% | 90.71% |
CHEMBL2581 | P07339 | Cathepsin D | 81.90% | 98.95% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 81.78% | 92.50% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 81.21% | 94.80% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 80.07% | 86.92% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Citharexylum caudatum |
PubChem | 11050045 |
LOTUS | LTS0210144 |
wikiData | Q105154186 |