methyl (2S,3S,4S,5R,6R)-6-[[(3S,4aR,6aR,6bS,8R,8aR,12aS,14aR,14bR)-8a-[(2S,3R,4S,5S)-4,5-dihydroxy-3-[(E)-3-[3-methoxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]prop-2-enoyl]oxyoxan-2-yl]oxycarbonyl-8-hydroxy-4,4,6a,6b,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-3,4,5-trihydroxyoxane-2-carboxylate
Internal ID | f544c82e-dffa-4e55-a14e-94be2bfce3f0 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Triterpene glycosides > Triterpene saponins |
IUPAC Name | methyl (2S,3S,4S,5R,6R)-6-[[(3S,4aR,6aR,6bS,8R,8aR,12aS,14aR,14bR)-8a-[(2S,3R,4S,5S)-4,5-dihydroxy-3-[(E)-3-[3-methoxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]prop-2-enoyl]oxyoxan-2-yl]oxycarbonyl-8-hydroxy-4,4,6a,6b,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-3,4,5-trihydroxyoxane-2-carboxylate |
SMILES (Canonical) | CC1(CCC2(C(C1)C3=CCC4C5(CCC(C(C5CCC4(C3(CC2O)C)C)(C)C)OC6C(C(C(C(O6)C(=O)OC)O)O)O)C)C(=O)OC7C(C(C(CO7)O)O)OC(=O)C=CC8=CC(=C(C=C8)OC9C(C(C(C(O9)CO)O)O)O)OC)C |
SMILES (Isomeric) | C[C@]12CC[C@@H](C([C@@H]1CC[C@@]3([C@@H]2CC=C4[C@]3(C[C@H]([C@@]5([C@H]4CC(CC5)(C)C)C(=O)O[C@H]6[C@@H]([C@H]([C@H](CO6)O)O)OC(=O)/C=C/C7=CC(=C(C=C7)O[C@H]8[C@@H]([C@H]([C@@H]([C@H](O8)CO)O)O)O)OC)O)C)C)(C)C)O[C@H]9[C@@H]([C@H]([C@@H]([C@H](O9)C(=O)OC)O)O)O |
InChI | InChI=1S/C58H84O22/c1-53(2)20-21-58(52(71)80-51-47(39(63)30(60)26-74-51)78-38(62)15-11-27-10-13-31(32(22-27)72-8)75-49-44(68)41(65)40(64)33(25-59)76-49)29(23-53)28-12-14-35-55(5)18-17-37(77-50-45(69)42(66)43(67)46(79-50)48(70)73-9)54(3,4)34(55)16-19-56(35,6)57(28,7)24-36(58)61/h10-13,15,22,29-30,33-37,39-47,49-51,59-61,63-69H,14,16-21,23-26H2,1-9H3/b15-11+/t29-,30-,33+,34-,35+,36+,37-,39-,40+,41-,42-,43-,44+,45+,46-,47+,49+,50+,51-,55-,56+,57+,58+/m0/s1 |
InChI Key | FQDYAELZPDIZMA-OYZHINADSA-N |
Popularity | 0 references in papers |
Molecular Formula | C58H84O22 |
Molecular Weight | 1133.30 g/mol |
Exact Mass | 1132.54542430 g/mol |
Topological Polar Surface Area (TPSA) | 337.00 Ų |
XlogP | 4.60 |
There are no found synonyms. |
![2D Structure of methyl (2S,3S,4S,5R,6R)-6-[[(3S,4aR,6aR,6bS,8R,8aR,12aS,14aR,14bR)-8a-[(2S,3R,4S,5S)-4,5-dihydroxy-3-[(E)-3-[3-methoxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]prop-2-enoyl]oxyoxan-2-yl]oxycarbonyl-8-hydroxy-4,4,6a,6b,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-3,4,5-trihydroxyoxane-2-carboxylate 2D Structure of methyl (2S,3S,4S,5R,6R)-6-[[(3S,4aR,6aR,6bS,8R,8aR,12aS,14aR,14bR)-8a-[(2S,3R,4S,5S)-4,5-dihydroxy-3-[(E)-3-[3-methoxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]prop-2-enoyl]oxyoxan-2-yl]oxycarbonyl-8-hydroxy-4,4,6a,6b,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-3,4,5-trihydroxyoxane-2-carboxylate](https://plantaedb.com/storage/docs/compounds/2023/11/5bfe3300-85c8-11ee-be61-f70ffb807091.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.69% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.17% | 86.33% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.91% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.62% | 96.09% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 93.92% | 96.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.83% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.70% | 97.09% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 92.13% | 96.21% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.56% | 89.00% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 87.66% | 92.98% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 87.32% | 92.62% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 87.06% | 91.07% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 86.97% | 89.62% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 86.21% | 89.67% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.14% | 100.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.73% | 99.17% |
CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 85.55% | 85.49% |
CHEMBL5028 | O14672 | ADAM10 | 85.43% | 97.50% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 84.48% | 90.17% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 84.41% | 95.50% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 84.35% | 94.75% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.34% | 95.89% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 83.53% | 97.14% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 82.12% | 94.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Tragopogon porrifolius |
PubChem | 163193112 |
LOTUS | LTS0074527 |
wikiData | Q104999563 |