5beta-Cholanic acid
Internal ID | 6e04e506-7ff5-4a73-bdad-54432e3e7fdb |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Bile acids, alcohols and derivatives |
IUPAC Name | (4R)-4-[(5S,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
SMILES (Canonical) | CC(CCC(=O)O)C1CCC2C1(CCC3C2CCC4C3(CCCC4)C)C |
SMILES (Isomeric) | C[C@H](CCC(=O)O)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC[C@H]4[C@@]3(CCCC4)C)C |
InChI | InChI=1S/C24H40O2/c1-16(7-12-22(25)26)19-10-11-20-18-9-8-17-6-4-5-14-23(17,2)21(18)13-15-24(19,20)3/h16-21H,4-15H2,1-3H3,(H,25,26)/t16-,17+,18+,19-,20+,21+,23+,24-/m1/s1 |
InChI Key | RPKLZQLYODPWTM-LVVAJZGHSA-N |
Popularity | 173 references in papers |
Molecular Formula | C24H40O2 |
Molecular Weight | 360.60 g/mol |
Exact Mass | 360.302830514 g/mol |
Topological Polar Surface Area (TPSA) | 37.30 Ų |
XlogP | 8.00 |
Atomic LogP (AlogP) | 6.54 |
H-Bond Acceptor | 1 |
H-Bond Donor | 1 |
Rotatable Bonds | 4 |
Ursocholanic acid |
546-18-9 |
5beta-Cholanoic acid |
5beta-Cholan-24-oic acid |
Cholanoic acid |
5|A-Cholanic acid |
5-Beta-Cholanic Acid |
Cholanic acid, (5beta)- |
5.beta.-Cholanic acid |
5.beta.-Cholanoic acid |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 1.0000 | 100.00% |
Caco-2 | - | 0.5432 | 54.32% |
Blood Brain Barrier | + | 0.8000 | 80.00% |
Human oral bioavailability | - | 0.5286 | 52.86% |
Subcellular localzation | Mitochondria | 0.4465 | 44.65% |
OATP2B1 inhibitior | - | 0.5993 | 59.93% |
OATP1B1 inhibitior | + | 0.7567 | 75.67% |
OATP1B3 inhibitior | + | 0.9480 | 94.80% |
MATE1 inhibitior | - | 0.9600 | 96.00% |
OCT2 inhibitior | + | 0.5250 | 52.50% |
BSEP inhibitior | + | 0.8233 | 82.33% |
P-glycoprotein inhibitior | + | 0.6836 | 68.36% |
P-glycoprotein substrate | - | 0.8331 | 83.31% |
CYP3A4 substrate | + | 0.7083 | 70.83% |
CYP2C9 substrate | - | 0.5629 | 56.29% |
CYP2D6 substrate | - | 0.8695 | 86.95% |
CYP3A4 inhibition | - | 0.8936 | 89.36% |
CYP2C9 inhibition | - | 0.8546 | 85.46% |
CYP2C19 inhibition | - | 0.9347 | 93.47% |
CYP2D6 inhibition | - | 0.9669 | 96.69% |
CYP1A2 inhibition | - | 0.7565 | 75.65% |
CYP2C8 inhibition | - | 0.8924 | 89.24% |
CYP inhibitory promiscuity | - | 0.9632 | 96.32% |
UGT catelyzed | - | 0.0000 | 0.00% |
Carcinogenicity (binary) | - | 0.8400 | 84.00% |
Carcinogenicity (trinary) | Non-required | 0.6738 | 67.38% |
Eye corrosion | - | 0.9740 | 97.40% |
Eye irritation | - | 0.8971 | 89.71% |
Skin irritation | - | 0.5242 | 52.42% |
Skin corrosion | - | 0.9472 | 94.72% |
Ames mutagenesis | - | 0.8900 | 89.00% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.6494 | 64.94% |
Micronuclear | - | 0.9400 | 94.00% |
Hepatotoxicity | - | 0.6114 | 61.14% |
skin sensitisation | + | 0.4931 | 49.31% |
Respiratory toxicity | + | 0.8889 | 88.89% |
Reproductive toxicity | + | 0.8333 | 83.33% |
Mitochondrial toxicity | + | 0.5875 | 58.75% |
Nephrotoxicity | - | 0.9488 | 94.88% |
Acute Oral Toxicity (c) | III | 0.7910 | 79.10% |
Estrogen receptor binding | + | 0.7784 | 77.84% |
Androgen receptor binding | + | 0.7145 | 71.45% |
Thyroid receptor binding | + | 0.6995 | 69.95% |
Glucocorticoid receptor binding | + | 0.9153 | 91.53% |
Aromatase binding | + | 0.6535 | 65.35% |
PPAR gamma | + | 0.6031 | 60.31% |
Honey bee toxicity | - | 0.8734 | 87.34% |
Biodegradation | - | 0.6250 | 62.50% |
Crustacea aquatic toxicity | - | 0.6700 | 67.00% |
Fish aquatic toxicity | + | 0.9849 | 98.49% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 |
6080 nM |
EC50 |
PMID: 18307294
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL237 | P41145 | Kappa opioid receptor | 97.95% | 98.10% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.63% | 96.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.33% | 97.25% |
CHEMBL2581 | P07339 | Cathepsin D | 93.86% | 98.95% |
CHEMBL236 | P41143 | Delta opioid receptor | 93.15% | 99.35% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 92.86% | 90.17% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 92.43% | 96.38% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.22% | 94.45% |
CHEMBL233 | P35372 | Mu opioid receptor | 90.99% | 97.93% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 90.63% | 93.04% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 89.72% | 93.56% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 89.58% | 82.69% |
CHEMBL274 | P51681 | C-C chemokine receptor type 5 | 87.99% | 98.77% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 87.50% | 100.00% |
CHEMBL238 | Q01959 | Dopamine transporter | 86.65% | 95.88% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.46% | 90.71% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.48% | 97.09% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.45% | 91.19% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 84.18% | 92.50% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 83.84% | 93.00% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 83.53% | 96.47% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 82.94% | 91.11% |
CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 82.06% | 96.03% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.89% | 100.00% |
CHEMBL2514 | O95665 | Neurotensin receptor 2 | 81.43% | 100.00% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 81.02% | 97.50% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 80.98% | 89.05% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 80.82% | 95.50% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.36% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Abrus precatorius |
PubChem | 92803 |
NPASS | NPC42060 |
ChEMBL | CHEMBL429432 |