[15-(3-Acetamido-2-hydroxy-3-phenylpropanoyl)oxy-4,12-diacetyloxy-1,9-dihydroxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate
Internal ID | cf83ab47-a9f0-40d0-8533-ac5dbd26905b |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Taxanes and derivatives |
IUPAC Name | [15-(3-acetamido-2-hydroxy-3-phenylpropanoyl)oxy-4,12-diacetyloxy-1,9-dihydroxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate |
SMILES (Canonical) | CC1=C2C(C(=O)C3(C(CC4C(C3C(C(C2(C)C)(CC1OC(=O)C(C(C5=CC=CC=C5)NC(=O)C)O)O)OC(=O)C6=CC=CC=C6)(CO4)OC(=O)C)O)C)OC(=O)C |
SMILES (Isomeric) | CC1=C2C(C(=O)C3(C(CC4C(C3C(C(C2(C)C)(CC1OC(=O)C(C(C5=CC=CC=C5)NC(=O)C)O)O)OC(=O)C6=CC=CC=C6)(CO4)OC(=O)C)O)C)OC(=O)C |
InChI | InChI=1S/C42H49NO14/c1-21-27(55-38(51)32(48)31(43-22(2)44)25-14-10-8-11-15-25)19-42(52)36(56-37(50)26-16-12-9-13-17-26)34-40(7,28(47)18-29-41(34,20-53-29)57-24(4)46)35(49)33(54-23(3)45)30(21)39(42,5)6/h8-17,27-29,31-34,36,47-48,52H,18-20H2,1-7H3,(H,43,44) |
InChI Key | NANZRVGWMMGVIQ-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C42H49NO14 |
Molecular Weight | 791.80 g/mol |
Exact Mass | 791.31530524 g/mol |
Topological Polar Surface Area (TPSA) | 221.00 Ų |
XlogP | 0.80 |
There are no found synonyms. |
![2D Structure of [15-(3-Acetamido-2-hydroxy-3-phenylpropanoyl)oxy-4,12-diacetyloxy-1,9-dihydroxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate 2D Structure of [15-(3-Acetamido-2-hydroxy-3-phenylpropanoyl)oxy-4,12-diacetyloxy-1,9-dihydroxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate](https://plantaedb.com/storage/docs/compounds/2023/11/5beb6050-8417-11ee-bc62-db6ee8cdd007.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL221 | P23219 | Cyclooxygenase-1 | 99.81% | 90.17% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.92% | 85.14% |
CHEMBL2581 | P07339 | Cathepsin D | 98.70% | 98.95% |
CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 97.97% | 87.67% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.45% | 91.11% |
CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 96.33% | 81.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 95.50% | 91.49% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 94.00% | 95.50% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.88% | 86.33% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.76% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.50% | 95.56% |
CHEMBL5028 | O14672 | ADAM10 | 90.89% | 97.50% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.68% | 99.23% |
CHEMBL2535 | P11166 | Glucose transporter | 90.08% | 98.75% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 89.94% | 91.19% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 89.50% | 83.00% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 89.18% | 94.62% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.88% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.78% | 97.09% |
CHEMBL4267 | P37173 | TGF-beta receptor type II | 88.61% | 88.18% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.59% | 89.00% |
CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 87.43% | 89.44% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 87.21% | 96.47% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 85.97% | 94.08% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.43% | 96.00% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 84.50% | 97.14% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 83.69% | 97.79% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 83.19% | 92.98% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.82% | 99.17% |
CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 81.94% | 92.67% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 81.00% | 98.75% |
CHEMBL5284 | Q96RR4 | CaM-kinase kinase beta | 80.81% | 89.23% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.29% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Taxus canadensis |
PubChem | 22085002 |
LOTUS | LTS0088062 |
wikiData | Q105176427 |