6-methoxy-3-(2-oxochromen-7-yl)oxy-7-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-2-one
Internal ID | 5768fbe5-8863-4f11-92a7-6299910daac9 |
Taxonomy | Phenylpropanoids and polyketides > Coumarins and derivatives > Coumarin glycosides |
IUPAC Name | 6-methoxy-3-(2-oxochromen-7-yl)oxy-7-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-2-one |
SMILES (Canonical) | COC1=C(C=C2C(=C1)C=C(C(=O)O2)OC3=CC4=C(C=C3)C=CC(=O)O4)OC5C(C(C(C(O5)CO)O)O)O |
SMILES (Isomeric) | COC1=C(C=C2C(=C1)C=C(C(=O)O2)OC3=CC4=C(C=C3)C=CC(=O)O4)O[C@H]5[C@@H]([C@H]([C@H]([C@H](O5)CO)O)O)O |
InChI | InChI=1S/C25H22O12/c1-32-16-6-12-7-18(33-13-4-2-11-3-5-20(27)34-14(11)8-13)24(31)35-15(12)9-17(16)36-25-23(30)22(29)21(28)19(10-26)37-25/h2-9,19,21-23,25-26,28-30H,10H2,1H3/t19-,21+,22+,23-,25-/m1/s1 |
InChI Key | WYIIRKFHBPIFQZ-BQYMIBSYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C25H22O12 |
Molecular Weight | 514.40 g/mol |
Exact Mass | 514.11112613 g/mol |
Topological Polar Surface Area (TPSA) | 170.00 Ų |
XlogP | 1.40 |
There are no found synonyms. |
![2D Structure of 6-methoxy-3-(2-oxochromen-7-yl)oxy-7-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-2-one 2D Structure of 6-methoxy-3-(2-oxochromen-7-yl)oxy-7-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-2-one](https://plantaedb.com/storage/docs/compounds/2023/11/5be11070-83c6-11ee-80d6-ef8a15d91c61.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL220 | P22303 | Acetylcholinesterase | 98.32% | 94.45% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.57% | 91.11% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 96.11% | 94.00% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 91.64% | 86.92% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.51% | 95.56% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.47% | 99.17% |
CHEMBL2581 | P07339 | Cathepsin D | 91.31% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.77% | 97.09% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.39% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.12% | 85.14% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 88.43% | 96.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 88.16% | 90.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.55% | 86.33% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.61% | 94.73% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 81.54% | 96.21% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.65% | 95.89% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 80.18% | 97.36% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Stellera chamaejasme |
PubChem | 21626655 |
LOTUS | LTS0053435 |
wikiData | Q105322227 |