5,7-dihydroxy-2-[3-hydroxy-4-[(2S,3S,4S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-6-methoxychromen-4-one
Internal ID | 3068cb20-2e4d-4ac4-b4e2-70849e9da084 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides |
IUPAC Name | 5,7-dihydroxy-2-[3-hydroxy-4-[(2S,3S,4S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-6-methoxychromen-4-one |
SMILES (Canonical) | COC1=C(C2=C(C=C1O)OC(=CC2=O)C3=CC(=C(C=C3)OC4C(C(C(C(O4)CO)O)O)O)O)O |
SMILES (Isomeric) | COC1=C(C2=C(C=C1O)OC(=CC2=O)C3=CC(=C(C=C3)O[C@H]4[C@H]([C@H]([C@@H]([C@@H](O4)CO)O)O)O)O)O |
InChI | InChI=1S/C22H22O12/c1-31-21-11(26)6-14-16(18(21)28)10(25)5-13(32-14)8-2-3-12(9(24)4-8)33-22-20(30)19(29)17(27)15(7-23)34-22/h2-6,15,17,19-20,22-24,26-30H,7H2,1H3/t15-,17+,19-,20-,22+/m0/s1 |
InChI Key | FKEFURJFBYTFMP-NFXVSDQMSA-N |
Popularity | 0 references in papers |
Molecular Formula | C22H22O12 |
Molecular Weight | 478.40 g/mol |
Exact Mass | 478.11112613 g/mol |
Topological Polar Surface Area (TPSA) | 196.00 Ų |
XlogP | 0.50 |
There are no found synonyms. |
![2D Structure of 5,7-dihydroxy-2-[3-hydroxy-4-[(2S,3S,4S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-6-methoxychromen-4-one 2D Structure of 5,7-dihydroxy-2-[3-hydroxy-4-[(2S,3S,4S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-6-methoxychromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/5bbf0360-85c4-11ee-8ea3-67b7ab675302.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.12% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.29% | 85.14% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 97.45% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 95.89% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.28% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.32% | 86.33% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 91.18% | 83.57% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 90.24% | 96.21% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 89.88% | 86.92% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.74% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.29% | 94.45% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 88.16% | 99.15% |
CHEMBL3194 | P02766 | Transthyretin | 87.56% | 90.71% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.81% | 99.17% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.37% | 94.73% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.69% | 96.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.54% | 97.09% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 83.35% | 95.78% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.25% | 95.89% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.67% | 95.56% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.46% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cirsium oligophyllum |
PubChem | 163038657 |
LOTUS | LTS0237810 |
wikiData | Q104996546 |