11,18,19,21-Tetrahydroxy-7-methyl-7-(4-methylpent-3-enyl)-16-prop-1-en-2-yl-2,8-dioxapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1(14),3(12),4(9),5,10,17(22),18,20-octaen-13-one
Internal ID | db2cc781-c4d7-4c5c-af48-ebd340e2d526 |
Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Xanthones > Pyranoxanthones |
IUPAC Name | 11,18,19,21-tetrahydroxy-7-methyl-7-(4-methylpent-3-enyl)-16-prop-1-en-2-yl-2,8-dioxapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1(14),3(12),4(9),5,10,17(22),18,20-octaen-13-one |
SMILES (Canonical) | CC(=CCCC1(C=CC2=C(O1)C=C(C3=C2OC4=C(C3=O)CC(C5=C4C(=CC(=C5O)O)O)C(=C)C)O)C)C |
SMILES (Isomeric) | CC(=CCCC1(C=CC2=C(O1)C=C(C3=C2OC4=C(C3=O)CC(C5=C4C(=CC(=C5O)O)O)C(=C)C)O)C)C |
InChI | InChI=1S/C30H30O7/c1-14(2)7-6-9-30(5)10-8-16-22(37-30)13-20(32)25-26(34)18-11-17(15(3)4)23-24(29(18)36-28(16)25)19(31)12-21(33)27(23)35/h7-8,10,12-13,17,31-33,35H,3,6,9,11H2,1-2,4-5H3 |
InChI Key | XIAMMYUBNVLJFA-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C30H30O7 |
Molecular Weight | 502.60 g/mol |
Exact Mass | 502.19915329 g/mol |
Topological Polar Surface Area (TPSA) | 116.00 Ų |
XlogP | 6.70 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.97% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 99.05% | 94.45% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.65% | 89.00% |
CHEMBL2581 | P07339 | Cathepsin D | 95.57% | 98.95% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 93.75% | 91.49% |
CHEMBL3401 | O75469 | Pregnane X receptor | 92.86% | 94.73% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 91.59% | 89.34% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 90.79% | 90.71% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.65% | 95.89% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.39% | 95.56% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 89.33% | 94.80% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.79% | 100.00% |
CHEMBL3038469 | P24941 | CDK2/Cyclin A | 88.66% | 91.38% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.12% | 96.09% |
CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 87.53% | 85.30% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.62% | 86.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.82% | 99.17% |
CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 84.32% | 85.11% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.65% | 92.62% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.73% | 97.09% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.70% | 99.23% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 82.42% | 94.42% |
CHEMBL5555 | O00767 | Acyl-CoA desaturase | 81.26% | 97.50% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 80.08% | 96.38% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Artocarpus altilis |
PubChem | 163014192 |
LOTUS | LTS0261167 |
wikiData | Q105328390 |