Spiro(7H-indeno(4,5-d)-1,3-dioxole-7,1'(2'H)-isoquinolin)-6'-ol, 3',4',6,8-tetrahydro-7'-methoxy-2'-methyl-6-methylene-, (S)-
| Internal ID | c83925c5-5392-4232-9c14-fc3ea5e50fb4 |
| Taxonomy | Organoheterocyclic compounds > Tetrahydroisoquinolines |
| IUPAC Name | 7-methoxy-2-methyl-6'-methylidenespiro[3,4-dihydroisoquinoline-1,7'-8H-cyclopenta[g][1,3]benzodioxole]-6-ol |
| SMILES (Canonical) | CN1CCC2=CC(=C(C=C2C13CC4=C(C3=C)C=CC5=C4OCO5)OC)O |
| SMILES (Isomeric) | CN1CCC2=CC(=C(C=C2C13CC4=C(C3=C)C=CC5=C4OCO5)OC)O |
| InChI | InChI=1S/C21H21NO4/c1-12-14-4-5-18-20(26-11-25-18)15(14)10-21(12)16-9-19(24-3)17(23)8-13(16)6-7-22(21)2/h4-5,8-9,23H,1,6-7,10-11H2,2-3H3 |
| InChI Key | MDAWGFZRYVVBAS-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C21H21NO4 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.14705815 g/mol |
| Topological Polar Surface Area (TPSA) | 51.20 Ų |
| XlogP | 3.20 |
| Spiro(7H-indeno(4,5-d)-1,3-dioxole-7,1'(2'H)-isoquinolin)-6'-ol, 3',4',6,8-tetrahydro-7'-methoxy-2'-methyl-6-methylene-, (S)- |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.75% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.46% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.50% | 98.95% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 96.61% | 96.77% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 96.26% | 93.40% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.59% | 95.56% |
| CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 93.27% | 82.67% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.52% | 86.33% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 92.05% | 90.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.94% | 95.89% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.97% | 94.00% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 87.46% | 91.00% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 86.49% | 92.62% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 85.95% | 89.62% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 84.51% | 93.99% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 84.43% | 82.38% |
| CHEMBL4895 | P30530 | Tyrosine-protein kinase receptor UFO | 84.22% | 90.95% |
| CHEMBL5747 | Q92793 | CREB-binding protein | 84.03% | 95.12% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 83.33% | 92.94% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 82.64% | 91.79% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 82.48% | 89.50% |
| CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 81.97% | 96.25% |
| CHEMBL4940 | P07195 | L-lactate dehydrogenase B chain | 81.92% | 95.53% |
| CHEMBL4247 | Q9UM73 | ALK tyrosine kinase receptor | 81.06% | 96.86% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.65% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Corydalis ochotensis |
| Corydalis sibirica |
| PubChem | 165279 |
| LOTUS | LTS0152913 |
| wikiData | Q105161576 |