[2-[[15-(5,6-Dihydroxy-6-methylheptan-2-yl)-9,14-dihydroxy-7,7,12,16-tetramethyl-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]oxy]-5-hydroxy-3-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-4-yl] acetate
| Internal ID | b447121f-74cc-4b27-a182-8d2a72de5fc6 |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins > Cucurbitacin glycosides |
| IUPAC Name | [2-[[15-(5,6-dihydroxy-6-methylheptan-2-yl)-9,14-dihydroxy-7,7,12,16-tetramethyl-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]oxy]-5-hydroxy-3-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-4-yl] acetate |
| SMILES (Canonical) | CC(CCC(C(C)(C)O)O)C1C(CC2(C1(CCC34C2CC(C5C3(C4)CCC(C5(C)C)OC6C(C(C(CO6)O)OC(=O)C)OC7C(C(C(CO7)O)O)O)O)C)C)O |
| SMILES (Isomeric) | CC(CCC(C(C)(C)O)O)C1C(CC2(C1(CCC34C2CC(C5C3(C4)CCC(C5(C)C)OC6C(C(C(CO6)O)OC(=O)C)OC7C(C(C(CO7)O)O)O)O)C)C)O |
| InChI | InChI=1S/C42H70O14/c1-20(9-10-27(48)38(5,6)51)29-23(45)16-40(8)26-15-22(44)34-37(3,4)28(11-12-42(34)19-41(26,42)14-13-39(29,40)7)55-36-33(32(54-21(2)43)25(47)18-53-36)56-35-31(50)30(49)24(46)17-52-35/h20,22-36,44-51H,9-19H2,1-8H3 |
| InChI Key | AVQLBIFRCZFBNU-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C42H70O14 |
| Molecular Weight | 799.00 g/mol |
| Exact Mass | 798.47655690 g/mol |
| Topological Polar Surface Area (TPSA) | 225.00 Ų |
| XlogP | 2.10 |
| There are no found synonyms. |
![2D Structure of [2-[[15-(5,6-Dihydroxy-6-methylheptan-2-yl)-9,14-dihydroxy-7,7,12,16-tetramethyl-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]oxy]-5-hydroxy-3-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-4-yl] acetate](https://plantaedb.com/storage/docs/compounds/2023/11/5b0fadc0-85dc-11ee-8ec9-85ca89faeded.jpg "2D Structure of [2-[[15-(5,6-Dihydroxy-6-methylheptan-2-yl)-9,14-dihydroxy-7,7,12,16-tetramethyl-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]oxy]-5-hydroxy-3-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-4-yl] acetate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 99.71% | 97.25% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.90% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.93% | 91.11% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 94.76% | 95.58% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 94.59% | 96.77% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.53% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.66% | 94.45% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 91.61% | 92.88% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 91.60% | 91.24% |
| CHEMBL284 | P27487 | Dipeptidyl peptidase IV | 91.11% | 95.69% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 90.32% | 95.71% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 90.20% | 91.19% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.86% | 89.00% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 89.63% | 82.69% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 89.62% | 97.14% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 89.56% | 96.47% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.13% | 97.09% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 89.12% | 95.17% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 88.38% | 85.14% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 88.07% | 91.07% |
| CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 87.91% | 100.00% |
| CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 87.73% | 82.50% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 87.52% | 95.71% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 87.52% | 100.00% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 87.50% | 97.21% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 87.39% | 98.75% |
| CHEMBL204 | P00734 | Thrombin | 87.11% | 96.01% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 85.95% | 91.03% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 85.86% | 89.50% |
| CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 85.42% | 85.31% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 84.88% | 100.00% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 84.60% | 94.33% |
| CHEMBL2007625 | O75874 | Isocitrate dehydrogenase [NADP] cytoplasmic | 83.78% | 99.00% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 83.53% | 96.61% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.46% | 95.89% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 83.45% | 94.62% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 82.77% | 89.34% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.56% | 95.89% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.55% | 92.62% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.05% | 100.00% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 81.89% | 90.24% |
| CHEMBL4482 | O96013 | Serine/threonine-protein kinase PAK 4 | 81.56% | 95.42% |
| CHEMBL4660 | P28907 | Lymphocyte differentiation antigen CD38 | 81.26% | 95.27% |
| CHEMBL1907598 | P05106 | Integrin alpha-V/beta-3 | 81.24% | 95.71% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 81.05% | 96.95% |
| CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR | 80.97% | 92.78% |
| CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 80.93% | 94.78% |
| CHEMBL5028 | O14672 | ADAM10 | 80.66% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Astragalus taschkendicus |
| PubChem | 162911054 |
| LOTUS | LTS0211710 |
| wikiData | Q104919731 |