5alpha-Tomatidan-3beta-ol
Internal ID | 6bf63f8c-51fa-4efa-a959-d7297d43297d |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal alkaloids > Spirosolanes and derivatives |
IUPAC Name | (1R,2S,4S,5'S,6R,7S,8R,9S,12S,13S,16S,18S)-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-piperidine]-16-ol |
SMILES (Canonical) | CC1CCC2(C(C3C(O2)CC4C3(CCC5C4CCC6C5(CCC(C6)O)C)C)C)NC1 |
SMILES (Isomeric) | C[C@H]1CC[C@@]2([C@H]([C@H]3[C@@H](O2)C[C@@H]4[C@@]3(CC[C@H]5[C@H]4CC[C@@H]6[C@@]5(CC[C@@H](C6)O)C)C)C)NC1 |
InChI | InChI=1S/C27H45NO2/c1-16-7-12-27(28-15-16)17(2)24-23(30-27)14-22-20-6-5-18-13-19(29)8-10-25(18,3)21(20)9-11-26(22,24)4/h16-24,28-29H,5-15H2,1-4H3/t16-,17-,18-,19-,20+,21-,22-,23-,24-,25-,26-,27+/m0/s1 |
InChI Key | XYNPYHXGMWJBLV-PUHUBZITSA-N |
Popularity | 0 references in papers |
Molecular Formula | C27H45NO2 |
Molecular Weight | 415.70 g/mol |
Exact Mass | 415.345029678 g/mol |
Topological Polar Surface Area (TPSA) | 41.50 Ų |
XlogP | 6.20 |
NSC27592 |
(1R,2S,4S,5'S,6R,7S,8R,9S,12S,13S,16S,18S)-5',7,9,13-Tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-piperidine]-16-ol |
5.alpha.-Tomatidan-3.beta.-ol |
NSC-27592 |
Spirosolan-3-ol,5.alpha.,22.beta.,25S)- |
CHEMBL1998601 |
NCI60_002244 |
SMR000393749 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL4931 | Q15125 | 3-beta-hydroxysteroid-delta(8),delta(7)-isomerase |
583 nM |
Ki |
via Super-PRED
|
CHEMBL3577 | P00352 | Aldehyde dehydrogenase 1A1 |
398.1 nM |
Potency |
via Super-PRED
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.00% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.76% | 97.09% |
CHEMBL204 | P00734 | Thrombin | 95.10% | 96.01% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 92.89% | 89.05% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.66% | 91.11% |
CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 90.21% | 97.31% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 89.91% | 95.58% |
CHEMBL238 | Q01959 | Dopamine transporter | 89.38% | 95.88% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 89.30% | 97.25% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 89.01% | 100.00% |
CHEMBL233 | P35372 | Mu opioid receptor | 87.50% | 97.93% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 87.21% | 92.88% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 86.79% | 92.94% |
CHEMBL3045 | P05771 | Protein kinase C beta | 86.15% | 97.63% |
CHEMBL1871 | P10275 | Androgen Receptor | 85.95% | 96.43% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.74% | 94.45% |
CHEMBL237 | P41145 | Kappa opioid receptor | 85.04% | 98.10% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 85.03% | 96.38% |
CHEMBL1907601 | P11802 | Cyclin-dependent kinase 4/cyclin D1 | 84.75% | 98.99% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 84.02% | 91.03% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 82.93% | 96.61% |
CHEMBL4523377 | Q86WV6 | Stimulator of interferon genes protein | 82.57% | 95.48% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 82.53% | 96.95% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 81.79% | 97.79% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.34% | 95.89% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 80.95% | 93.18% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 80.80% | 97.28% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 80.77% | 93.04% |
CHEMBL4482 | O96013 | Serine/threonine-protein kinase PAK 4 | 80.65% | 95.42% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 80.10% | 90.17% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 80.03% | 98.35% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Solanum lycopersicum |
PubChem | 231410 |
LOTUS | LTS0108700 |
wikiData | Q105344579 |