[(1R,2R,3R,5R,7S,8R,11R,12S,13S,14S,15S)-13-acetyloxy-7-chloro-12,15-dihydroxy-1,11,15-trimethyl-6-methylidene-10,16-dioxo-4,9-dioxatetracyclo[12.4.0.03,5.08,12]octadec-17-en-2-yl] acetate
| Internal ID | 7cadde3b-fe0e-4fe9-8388-502831af950d |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Tricarboxylic acids and derivatives |
| IUPAC Name | [(1R,2R,3R,5R,7S,8R,11R,12S,13S,14S,15S)-13-acetyloxy-7-chloro-12,15-dihydroxy-1,11,15-trimethyl-6-methylidene-10,16-dioxo-4,9-dioxatetracyclo[12.4.0.03,5.08,12]octadec-17-en-2-yl] acetate |
| SMILES (Canonical) | CC1C(=O)OC2C1(C(C3C(C=CC(=O)C3(C)O)(C(C4C(O4)C(=C)C2Cl)OC(=O)C)C)OC(=O)C)O |
| SMILES (Isomeric) | C[C@H]1C(=O)O[C@@H]2[C@]1([C@H]([C@@H]3[C@@](C=CC(=O)[C@@]3(C)O)([C@H]([C@H]4[C@H](O4)C(=C)[C@@H]2Cl)OC(=O)C)C)OC(=O)C)O |
| InChI | InChI=1S/C24H29ClO10/c1-9-14(25)18-24(31,10(2)21(29)35-18)20(33-12(4)27)17-22(5,8-7-13(28)23(17,6)30)19(32-11(3)26)16-15(9)34-16/h7-8,10,14-20,30-31H,1H2,2-6H3/t10-,14-,15+,16+,17+,18-,19-,20-,22+,23+,24+/m0/s1 |
| InChI Key | ZMZWRXWIJZDCCP-UQRQEXTGSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C24H29ClO10 |
| Molecular Weight | 512.90 g/mol |
| Exact Mass | 512.1449248 g/mol |
| Topological Polar Surface Area (TPSA) | 149.00 Ų |
| XlogP | 0.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.70% | 91.11% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.05% | 85.14% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.52% | 94.45% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.99% | 86.33% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 88.05% | 91.19% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.31% | 96.09% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 86.81% | 94.80% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.17% | 94.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.70% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 82.93% | 98.95% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 81.76% | 94.73% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 81.25% | 91.07% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.73% | 97.14% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.29% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162908110 |
| LOTUS | LTS0077568 |
| wikiData | Q105379884 |