(4aR,6R,8aS)-6-[(2E,4E)-6-hydroxy-6-methylhepta-2,4-dien-2-yl]-4,8a-dimethyl-1,4a,5,6,7,8-hexahydronaphthalen-2-one
Internal ID | 2d3ece84-6d33-47de-8e85-12c1617528c1 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
IUPAC Name | (4aR,6R,8aS)-6-[(2E,4E)-6-hydroxy-6-methylhepta-2,4-dien-2-yl]-4,8a-dimethyl-1,4a,5,6,7,8-hexahydronaphthalen-2-one |
SMILES (Canonical) | CC1=CC(=O)CC2(C1CC(CC2)C(=CC=CC(C)(C)O)C)C |
SMILES (Isomeric) | CC1=CC(=O)C[C@]2([C@H]1C[C@@H](CC2)/C(=C/C=C/C(C)(C)O)/C)C |
InChI | InChI=1S/C20H30O2/c1-14(7-6-9-19(3,4)22)16-8-10-20(5)13-17(21)11-15(2)18(20)12-16/h6-7,9,11,16,18,22H,8,10,12-13H2,1-5H3/b9-6+,14-7+/t16-,18+,20+/m1/s1 |
InChI Key | BQQIWANTQQHPOM-UFRHCUBXSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H30O2 |
Molecular Weight | 302.50 g/mol |
Exact Mass | 302.224580195 g/mol |
Topological Polar Surface Area (TPSA) | 37.30 Ų |
XlogP | 4.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.70% | 97.25% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.40% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.44% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.81% | 97.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.16% | 100.00% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 87.97% | 93.04% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.90% | 96.09% |
CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 86.86% | 90.93% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.36% | 89.00% |
CHEMBL1871 | P10275 | Androgen Receptor | 85.10% | 96.43% |
CHEMBL2581 | P07339 | Cathepsin D | 85.10% | 98.95% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 83.23% | 94.75% |
CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 83.01% | 94.78% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 82.25% | 82.69% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.19% | 99.23% |
CHEMBL1902 | P62942 | FK506-binding protein 1A | 81.92% | 97.05% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 81.68% | 85.14% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.58% | 92.94% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.47% | 95.89% |
CHEMBL4829 | O00763 | Acetyl-CoA carboxylase 2 | 80.60% | 98.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.30% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Dysoxylum hongkongense |
PubChem | 10266932 |
LOTUS | LTS0237670 |
wikiData | Q104944507 |