methyl (E)-5-[(1S,2R,4aR,8aR)-1,2,4a,5-tetramethyl-7-oxo-3,4,8,8a-tetrahydro-2H-naphthalen-1-yl]-3-methylpent-2-enoate
Internal ID | 811dd414-cd22-447f-a6f5-5f86b8319daa |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Colensane and clerodane diterpenoids |
IUPAC Name | methyl (E)-5-[(1S,2R,4aR,8aR)-1,2,4a,5-tetramethyl-7-oxo-3,4,8,8a-tetrahydro-2H-naphthalen-1-yl]-3-methylpent-2-enoate |
SMILES (Canonical) | CC1CCC2(C(C1(C)CCC(=CC(=O)OC)C)CC(=O)C=C2C)C |
SMILES (Isomeric) | C[C@@H]1CC[C@@]2([C@@H]([C@@]1(C)CC/C(=C/C(=O)OC)/C)CC(=O)C=C2C)C |
InChI | InChI=1S/C21H32O3/c1-14(11-19(23)24-6)7-9-20(4)15(2)8-10-21(5)16(3)12-17(22)13-18(20)21/h11-12,15,18H,7-10,13H2,1-6H3/b14-11+/t15-,18-,20+,21+/m1/s1 |
InChI Key | SABQHVWRNLPVTQ-ZQTZVFAOSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C21H32O3 |
Molecular Weight | 332.50 g/mol |
Exact Mass | 332.23514488 g/mol |
Topological Polar Surface Area (TPSA) | 43.40 Ų |
XlogP | 5.10 |
There are no found synonyms. |
![2D Structure of methyl (E)-5-[(1S,2R,4aR,8aR)-1,2,4a,5-tetramethyl-7-oxo-3,4,8,8a-tetrahydro-2H-naphthalen-1-yl]-3-methylpent-2-enoate 2D Structure of methyl (E)-5-[(1S,2R,4aR,8aR)-1,2,4a,5-tetramethyl-7-oxo-3,4,8,8a-tetrahydro-2H-naphthalen-1-yl]-3-methylpent-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/5a7b13b0-8716-11ee-ada9-23088e7fc85d.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.68% | 91.11% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 97.44% | 83.82% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.57% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.26% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 91.97% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.43% | 95.56% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.67% | 100.00% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 84.42% | 94.80% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 84.10% | 91.07% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 82.78% | 97.25% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.20% | 86.33% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.63% | 94.33% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.80% | 97.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.57% | 89.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.15% | 95.89% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.07% | 91.19% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Solidago altissima |
PubChem | 12096942 |
LOTUS | LTS0165015 |
wikiData | Q104921802 |