Unk-DL-Leu-DL-Ala-DL-Leu-DL-Leu-DL-xiIle-DL-Arg-DL-Leu-DL-Leu-DL-Val-DL-Lys-DL-Leu-DL-xiThr(1)-DL-Leu-DL-Ala-DL-Lys-DL-Lys-(1)
| Internal ID | d68b00a5-400d-4190-99fe-1902a2fd80cb |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Depsipeptides > Cyclic depsipeptides |
| IUPAC Name | 6-amino-N-[1-[[3,6-bis(4-aminobutyl)-9,16-dimethyl-12-(2-methylpropyl)-2,5,8,11,14-pentaoxo-1-oxa-4,7,10,13-tetrazacyclohexadec-15-yl]amino]-4-methyl-1-oxopentan-2-yl]-2-[[2-[[2-[[2-[[5-(diaminomethylideneamino)-2-[[2-[[2-[[2-[2-[[2-(2,3-dihydroxypropanoylamino)-4-methylpentanoyl]amino]propanoylamino]-4-methylpentanoyl]amino]-4-methylpentanoyl]amino]-3-methylpentanoyl]amino]pentanoyl]amino]-4-methylpentanoyl]amino]-4-methylpentanoyl]amino]-3-methylbutanoyl]amino]hexanamide |
| SMILES (Canonical) | CCC(C)C(C(=O)NC(CCCN=C(N)N)C(=O)NC(CC(C)C)C(=O)NC(CC(C)C)C(=O)NC(C(C)C)C(=O)NC(CCCCN)C(=O)NC(CC(C)C)C(=O)NC1C(OC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC1=O)CC(C)C)C)CCCCN)CCCCN)C)NC(=O)C(CC(C)C)NC(=O)C(CC(C)C)NC(=O)C(C)NC(=O)C(CC(C)C)NC(=O)C(CO)O |
| SMILES (Isomeric) | CCC(C)C(C(=O)NC(CCCN=C(N)N)C(=O)NC(CC(C)C)C(=O)NC(CC(C)C)C(=O)NC(C(C)C)C(=O)NC(CCCCN)C(=O)NC(CC(C)C)C(=O)NC1C(OC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC1=O)CC(C)C)C)CCCCN)CCCCN)C)NC(=O)C(CC(C)C)NC(=O)C(CC(C)C)NC(=O)C(C)NC(=O)C(CC(C)C)NC(=O)C(CO)O |
| InChI | InChI=1S/C90H166N22O20/c1-22-54(18)71(111-83(125)67(43-51(12)13)107-80(122)64(40-48(6)7)103-74(116)56(20)98-78(120)62(38-46(2)3)108-85(127)69(114)45-113)87(129)101-60(33-29-37-96-90(94)95)77(119)104-65(41-49(8)9)81(123)106-66(42-50(10)11)82(124)110-70(53(16)17)86(128)100-59(31-24-27-35-92)76(118)105-68(44-52(14)15)84(126)112-72-57(21)132-89(131)61(32-25-28-36-93)102-75(117)58(30-23-26-34-91)99-73(115)55(19)97-79(121)63(39-47(4)5)109-88(72)130/h46-72,113-114H,22-45,91-93H2,1-21H3,(H,97,121)(H,98,120)(H,99,115)(H,100,128)(H,101,129)(H,102,117)(H,103,116)(H,104,119)(H,105,118)(H,106,123)(H,107,122)(H,108,127)(H,109,130)(H,110,124)(H,111,125)(H,112,126)(H4,94,95,96) |
| InChI Key | NGHWISNXEIEDJE-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C90H166N22O20 |
| Molecular Weight | 1876.40 g/mol |
| Exact Mass | 1875.26487577 g/mol |
| Topological Polar Surface Area (TPSA) | 675.00 Ų |
| XlogP | 4.20 |
| Atomic LogP (AlogP) | -1.45 |
| H-Bond Acceptor | 24 |
| H-Bond Donor | 23 |
| Rotatable Bonds | 58 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | - | 0.5906 | 59.06% |
| Caco-2 | - | 0.8589 | 85.89% |
| Blood Brain Barrier | - | 0.8500 | 85.00% |
| Human oral bioavailability | - | 0.6000 | 60.00% |
| Subcellular localzation | Mitochondria | 0.4288 | 42.88% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8252 | 82.52% |
| OATP1B3 inhibitior | + | 0.9338 | 93.38% |
| MATE1 inhibitior | - | 0.8800 | 88.00% |
| OCT2 inhibitior | - | 0.7750 | 77.50% |
| BSEP inhibitior | + | 0.9501 | 95.01% |
| P-glycoprotein inhibitior | + | 0.7418 | 74.18% |
| P-glycoprotein substrate | + | 0.9009 | 90.09% |
| CYP3A4 substrate | + | 0.7226 | 72.26% |
| CYP2C9 substrate | - | 1.0000 | 100.00% |
| CYP2D6 substrate | - | 0.8163 | 81.63% |
| CYP3A4 inhibition | - | 0.9416 | 94.16% |
| CYP2C9 inhibition | - | 0.9073 | 90.73% |
| CYP2C19 inhibition | - | 0.8825 | 88.25% |
| CYP2D6 inhibition | - | 0.9188 | 91.88% |
| CYP1A2 inhibition | - | 0.8898 | 88.98% |
| CYP2C8 inhibition | + | 0.6962 | 69.62% |
| CYP inhibitory promiscuity | - | 0.9947 | 99.47% |
| UGT catelyzed | + | 0.6000 | 60.00% |
| Carcinogenicity (binary) | - | 0.8600 | 86.00% |
| Carcinogenicity (trinary) | Non-required | 0.5880 | 58.80% |
| Eye corrosion | - | 0.9836 | 98.36% |
| Eye irritation | - | 0.8954 | 89.54% |
| Skin irritation | - | 0.7671 | 76.71% |
| Skin corrosion | - | 0.9215 | 92.15% |
| Ames mutagenesis | - | 0.5900 | 59.00% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.7014 | 70.14% |
| Micronuclear | + | 0.7400 | 74.00% |
| Hepatotoxicity | - | 0.5269 | 52.69% |
| skin sensitisation | - | 0.8224 | 82.24% |
| Respiratory toxicity | + | 0.7222 | 72.22% |
| Reproductive toxicity | + | 0.8556 | 85.56% |
| Mitochondrial toxicity | + | 0.7750 | 77.50% |
| Nephrotoxicity | + | 0.8616 | 86.16% |
| Acute Oral Toxicity (c) | III | 0.6199 | 61.99% |
| Estrogen receptor binding | + | 0.5597 | 55.97% |
| Androgen receptor binding | + | 0.7418 | 74.18% |
| Thyroid receptor binding | + | 0.7029 | 70.29% |
| Glucocorticoid receptor binding | + | 0.7917 | 79.17% |
| Aromatase binding | + | 0.7962 | 79.62% |
| PPAR gamma | + | 0.7873 | 78.73% |
| Honey bee toxicity | - | 0.7057 | 70.57% |
| Biodegradation | - | 0.8750 | 87.50% |
| Crustacea aquatic toxicity | - | 0.5200 | 52.00% |
| Fish aquatic toxicity | - | 0.8552 | 85.52% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3837 | P07711 | Cathepsin L | 99.99% | 96.61% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 99.53% | 98.05% |
| CHEMBL4072 | P07858 | Cathepsin B | 99.51% | 93.67% |
| CHEMBL2581 | P07339 | Cathepsin D | 99.38% | 98.95% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 98.50% | 83.82% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 98.20% | 93.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.31% | 96.09% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 97.08% | 96.47% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 96.93% | 100.00% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 96.28% | 88.42% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.93% | 99.17% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 95.80% | 98.33% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 95.70% | 97.23% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 95.27% | 93.10% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.18% | 91.11% |
| CHEMBL4018 | P49146 | Neuropeptide Y receptor type 2 | 95.08% | 98.94% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 94.77% | 89.63% |
| CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 94.52% | 92.32% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 94.24% | 96.11% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 93.89% | 92.88% |
| CHEMBL3776 | Q14790 | Caspase-8 | 93.55% | 97.06% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 93.14% | 100.00% |
| CHEMBL4801 | P29466 | Caspase-1 | 92.70% | 96.85% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 92.57% | 95.38% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 92.46% | 100.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.33% | 97.09% |
| CHEMBL2208 | P49137 | MAP kinase-activated protein kinase 2 | 92.28% | 95.20% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 92.06% | 98.03% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 91.84% | 95.58% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 91.80% | 96.90% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 90.88% | 95.00% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 90.64% | 93.18% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 90.48% | 94.66% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 89.84% | 96.00% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 89.51% | 95.71% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 88.59% | 97.29% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 88.51% | 90.71% |
| CHEMBL204 | P00734 | Thrombin | 87.17% | 96.01% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.87% | 95.56% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 85.99% | 89.50% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.51% | 91.19% |
| CHEMBL3308 | P55212 | Caspase-6 | 85.36% | 97.56% |
| CHEMBL4777 | P25929 | Neuropeptide Y receptor type 1 | 84.80% | 96.67% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 84.00% | 98.10% |
| CHEMBL4462 | Q8IXJ6 | NAD-dependent deacetylase sirtuin 2 | 83.91% | 90.24% |
| CHEMBL1075317 | P61964 | WD repeat-containing protein 5 | 83.80% | 96.33% |
| CHEMBL3468 | P55210 | Caspase-7 | 83.63% | 95.68% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 83.46% | 97.14% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 82.97% | 97.25% |
| CHEMBL3038469 | P24941 | CDK2/Cyclin A | 82.81% | 91.38% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 82.23% | 90.93% |
| CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 82.14% | 96.37% |
| CHEMBL236 | P41143 | Delta opioid receptor | 81.50% | 99.35% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 80.89% | 95.50% |
| CHEMBL4816 | Q9Y243 | Serine/threonine-protein kinase AKT3 | 80.79% | 96.28% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.66% | 95.89% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 80.36% | 90.08% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162816189 |
| LOTUS | LTS0246030 |
| wikiData | Q104172482 |