(1R,4R,5R,8R,11R,12S)-4,12-dimethyl-5-propan-2-yl-13-oxapentacyclo[10.2.2.01,9.04,8.09,11]hexadecan-14-one
| Internal ID | 73b70039-cc00-4cbb-9c71-3a3f570fb512 |
| Taxonomy | Organoheterocyclic compounds > Lactones |
| IUPAC Name | (1R,4R,5R,8R,11R,12S)-4,12-dimethyl-5-propan-2-yl-13-oxapentacyclo[10.2.2.01,9.04,8.09,11]hexadecan-14-one |
| SMILES (Canonical) | CC(C)C1CCC2C1(CCC34C25CC5C(CC3)(OC4=O)C)C |
| SMILES (Isomeric) | CC(C)[C@H]1CC[C@@H]2[C@@]1(CC[C@]34C25C[C@H]5[C@](CC3)(OC4=O)C)C |
| InChI | InChI=1S/C20H30O2/c1-12(2)13-5-6-14-17(13,3)7-9-19-10-8-18(4,22-16(19)21)15-11-20(14,15)19/h12-15H,5-11H2,1-4H3/t13-,14-,15+,17-,18+,19+,20?/m1/s1 |
| InChI Key | PVBHKDWHAKOECD-FLQPXRLYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.50 g/mol |
| Exact Mass | 302.224580195 g/mol |
| Topological Polar Surface Area (TPSA) | 26.30 Ų |
| XlogP | 5.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 98.90% | 96.38% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.76% | 97.25% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 89.81% | 97.14% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 89.66% | 82.69% |
| CHEMBL2581 | P07339 | Cathepsin D | 88.50% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.95% | 94.45% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 86.49% | 91.11% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 86.19% | 94.75% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.12% | 95.56% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.91% | 97.09% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 84.87% | 95.71% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.46% | 95.89% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 83.81% | 96.77% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.74% | 100.00% |
| CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 83.66% | 94.78% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 83.53% | 96.61% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 82.06% | 99.18% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 81.46% | 92.88% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.10% | 89.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 80.36% | 96.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Azorella cryptantha |
| PubChem | 163191133 |
| LOTUS | LTS0096920 |
| wikiData | Q105215374 |