[[4-[(7-Methoxy-1,3-benzodioxol-5-yl)methyl]-2-oxooxolan-3-yl]-(3,4,5-trimethoxyphenyl)methyl] acetate
| Internal ID | 9b47227a-765f-4d89-9cb4-80026e2eaa63 |
| Taxonomy | Lignans, neolignans and related compounds > Furanoid lignans > Tetrahydrofuran lignans > 9,9-epoxylignans > Dibenzylbutyrolactone lignans |
| IUPAC Name | [[4-[(7-methoxy-1,3-benzodioxol-5-yl)methyl]-2-oxooxolan-3-yl]-(3,4,5-trimethoxyphenyl)methyl] acetate |
| SMILES (Canonical) | CC(=O)OC(C1C(COC1=O)CC2=CC3=C(C(=C2)OC)OCO3)C4=CC(=C(C(=C4)OC)OC)OC |
| SMILES (Isomeric) | CC(=O)OC(C1C(COC1=O)CC2=CC3=C(C(=C2)OC)OCO3)C4=CC(=C(C(=C4)OC)OC)OC |
| InChI | InChI=1S/C25H28O10/c1-13(26)35-22(15-9-18(29-3)23(31-5)19(10-15)30-4)21-16(11-32-25(21)27)6-14-7-17(28-2)24-20(8-14)33-12-34-24/h7-10,16,21-22H,6,11-12H2,1-5H3 |
| InChI Key | UECPLTGUDPDDQM-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C25H28O10 |
| Molecular Weight | 488.50 g/mol |
| Exact Mass | 488.16824709 g/mol |
| Topological Polar Surface Area (TPSA) | 108.00 Ų |
| XlogP | 3.20 |
| There are no found synonyms. |
![2D Structure of [[4-[(7-Methoxy-1,3-benzodioxol-5-yl)methyl]-2-oxooxolan-3-yl]-(3,4,5-trimethoxyphenyl)methyl] acetate](https://plantaedb.com/storage/docs/compounds/2023/11/5a229ff0-8653-11ee-8071-094d29b0db57.jpg "2D Structure of [[4-[(7-Methoxy-1,3-benzodioxol-5-yl)methyl]-2-oxooxolan-3-yl]-(3,4,5-trimethoxyphenyl)methyl] acetate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.38% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.38% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.26% | 94.45% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 98.12% | 83.82% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.53% | 85.14% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.55% | 98.95% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 95.86% | 96.77% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 95.47% | 92.62% |
| CHEMBL261 | P00915 | Carbonic anhydrase I | 94.79% | 96.76% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.41% | 99.17% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 90.48% | 94.80% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.06% | 89.00% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 89.45% | 95.89% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 88.04% | 89.50% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.71% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.14% | 86.33% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.67% | 91.19% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 83.53% | 95.50% |
| CHEMBL3975 | P09467 | Fructose-1,6-bisphosphatase | 83.37% | 92.95% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 83.07% | 94.73% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.66% | 97.14% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 81.47% | 97.25% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.96% | 96.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.44% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Baccharis salicifolia subsp. salicifolia |
| Baccharis trinervis |
| Gutierrezia texana |
| Hernandia sonora |
| Solidago gigantea |
| PubChem | 162876896 |
| LOTUS | LTS0039528 |
| wikiData | Q105132619 |