methyl 2-[(1R,4aS,4bS,5R,8aS,9aR,10R,10aS)-10-acetyloxy-1-(furan-3-yl)-4b,6,6,10a-tetramethyl-4-methylidene-7-oxo-1,2,4a,5,8,8a,9a,10-octahydroindeno[5,6-b][1]benzofuran-5-yl]acetate
| Internal ID | d367050b-c016-4a59-96bb-864bde809977 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Dicarboxylic acids and derivatives |
| IUPAC Name | methyl 2-[(1R,4aS,4bS,5R,8aS,9aR,10R,10aS)-10-acetyloxy-1-(furan-3-yl)-4b,6,6,10a-tetramethyl-4-methylidene-7-oxo-1,2,4a,5,8,8a,9a,10-octahydroindeno[5,6-b][1]benzofuran-5-yl]acetate |
| SMILES (Canonical) | CC(=O)OC1C2C(C(=C)C3=CCC(C13C)C4=COC=C4)C5(C(O2)CC(=O)C(C5CC(=O)OC)(C)C)C |
| SMILES (Isomeric) | CC(=O)O[C@H]1[C@H]2[C@@H](C(=C)C3=CC[C@@H]([C@]13C)C4=COC=C4)[C@]5([C@@H](O2)CC(=O)C([C@@H]5CC(=O)OC)(C)C)C |
| InChI | InChI=1S/C29H36O7/c1-15-18-8-9-19(17-10-11-34-14-17)28(18,5)26(35-16(2)30)25-24(15)29(6)20(12-23(32)33-7)27(3,4)21(31)13-22(29)36-25/h8,10-11,14,19-20,22,24-26H,1,9,12-13H2,2-7H3/t19-,20+,22+,24-,25-,26+,28-,29-/m1/s1 |
| InChI Key | BBKKOWXDHHJENW-RIXYMHJZSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C29H36O7 |
| Molecular Weight | 496.60 g/mol |
| Exact Mass | 496.24610348 g/mol |
| Topological Polar Surface Area (TPSA) | 92.00 Ų |
| XlogP | 3.10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.90% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.52% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.56% | 94.45% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.27% | 86.33% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.66% | 85.14% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.66% | 98.95% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 90.12% | 94.73% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.36% | 94.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.32% | 99.23% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.03% | 95.56% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.95% | 99.17% |
| CHEMBL5028 | O14672 | ADAM10 | 84.96% | 97.50% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 84.89% | 95.50% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 84.72% | 90.00% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 83.99% | 91.24% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 82.86% | 97.79% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.41% | 92.62% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 81.67% | 94.80% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.06% | 91.19% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Turraea floribunda |
| PubChem | 12150038 |
| LOTUS | LTS0173314 |
| wikiData | Q104922812 |