(8E,22E)-4-hydroxy-2-oxa-11,16,20-triazatricyclo[22.2.2.13,7]nonacosa-1(26),3,5,7(29),8,22,24,27-octaene-10,21-dione
| Internal ID | 343e70da-dd48-4c3e-b35c-35098cea8f2f |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Ethers > Diarylethers |
| IUPAC Name | (8E,22E)-4-hydroxy-2-oxa-11,16,20-triazatricyclo[22.2.2.13,7]nonacosa-1(26),3,5,7(29),8,22,24,27-octaene-10,21-dione |
| SMILES (Canonical) | C1CCNC(=O)C=CC2=CC(=C(C=C2)O)OC3=CC=C(C=C3)C=CC(=O)NCCCNC1 |
| SMILES (Isomeric) | C1CCNC(=O)/C=C/C2=CC(=C(C=C2)O)OC3=CC=C(C=C3)/C=C/C(=O)NCCCNC1 |
| InChI | InChI=1S/C25H29N3O4/c29-22-11-6-20-8-13-25(31)27-16-2-1-14-26-15-3-17-28-24(30)12-7-19-4-9-21(10-5-19)32-23(22)18-20/h4-13,18,26,29H,1-3,14-17H2,(H,27,31)(H,28,30)/b12-7+,13-8+ |
| InChI Key | QBKGCCSZLPZTIE-INOXDZRUSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C25H29N3O4 |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.21580641 g/mol |
| Topological Polar Surface Area (TPSA) | 99.70 Ų |
| XlogP | 3.10 |
| There are no found synonyms. |
![2D Structure of (8E,22E)-4-hydroxy-2-oxa-11,16,20-triazatricyclo[22.2.2.13,7]nonacosa-1(26),3,5,7(29),8,22,24,27-octaene-10,21-dione](https://plantaedb.com/storage/docs/compounds/2023/11/59f139b0-8701-11ee-95fc-f10c2d6d6be1.jpg "2D Structure of (8E,22E)-4-hydroxy-2-oxa-11,16,20-triazatricyclo[22.2.2.13,7]nonacosa-1(26),3,5,7(29),8,22,24,27-octaene-10,21-dione")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.85% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.35% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.20% | 94.45% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.12% | 97.09% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 88.97% | 90.71% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 88.59% | 91.49% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 86.68% | 90.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.94% | 95.56% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.68% | 89.00% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 83.62% | 93.99% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.73% | 99.15% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.13% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Cadaba farinosa |
| PubChem | 15601702 |
| LOTUS | LTS0239862 |
| wikiData | Q105217855 |