2-[(3R,4aR,7aR,8R,10aS,10bR)-7,7a,10b-trimethyl-8-[[2-(2-methylbut-3-en-2-yl)-1H-indol-3-yl]methyl]-2,3,4a,5,8,9,10,10a-octahydro-1H-azuleno[5,4-b]pyran-3-yl]propan-2-ol
| Internal ID | 8e1a3e1c-0ef6-46e7-aeca-7934718f856e |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
| IUPAC Name | 2-[(3R,4aR,7aR,8R,10aS,10bR)-7,7a,10b-trimethyl-8-[[2-(2-methylbut-3-en-2-yl)-1H-indol-3-yl]methyl]-2,3,4a,5,8,9,10,10a-octahydro-1H-azuleno[5,4-b]pyran-3-yl]propan-2-ol |
| SMILES (Canonical) | CC1=CCC2C(CCC(O2)C(C)(C)O)(C3C1(C(CC3)CC4=C(NC5=CC=CC=C54)C(C)(C)C=C)C)C |
| SMILES (Isomeric) | CC1=CC[C@@H]2[C@](CC[C@@H](O2)C(C)(C)O)([C@@H]3[C@]1([C@H](CC3)CC4=C(NC5=CC=CC=C54)C(C)(C)C=C)C)C |
| InChI | InChI=1S/C33H47NO2/c1-9-30(3,4)29-24(23-12-10-11-13-25(23)34-29)20-22-15-16-26-32(7)19-18-27(31(5,6)35)36-28(32)17-14-21(2)33(22,26)8/h9-14,22,26-28,34-35H,1,15-20H2,2-8H3/t22-,26-,27-,28-,32-,33-/m1/s1 |
| InChI Key | AHUPTCAANZMABA-USDXWEPMSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C33H47NO2 |
| Molecular Weight | 489.70 g/mol |
| Exact Mass | 489.360679742 g/mol |
| Topological Polar Surface Area (TPSA) | 45.20 Ų |
| XlogP | 8.10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.46% | 91.11% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 97.71% | 94.75% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.05% | 94.45% |
| CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 95.43% | 85.49% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.30% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.71% | 98.95% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 94.50% | 88.56% |
| CHEMBL240 | Q12809 | HERG | 93.84% | 89.76% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 93.47% | 94.73% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 93.21% | 92.97% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.17% | 97.25% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 91.25% | 90.08% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 89.95% | 93.99% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.76% | 89.00% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 88.31% | 92.62% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.64% | 97.09% |
| CHEMBL325 | Q13547 | Histone deacetylase 1 | 86.05% | 95.92% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.66% | 100.00% |
| CHEMBL5028 | O14672 | ADAM10 | 85.35% | 97.50% |
| CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 84.50% | 89.44% |
| CHEMBL4530 | P00488 | Coagulation factor XIII | 83.54% | 96.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 83.32% | 96.09% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.37% | 100.00% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 82.04% | 96.21% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 81.47% | 91.71% |
| CHEMBL1829 | O15379 | Histone deacetylase 3 | 81.02% | 95.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.87% | 95.89% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.57% | 86.33% |
| CHEMBL2959 | Q08881 | Tyrosine-protein kinase ITK/TSK | 80.29% | 95.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 101671871 |
| LOTUS | LTS0110398 |
| wikiData | Q104912484 |