[(2R,3S,4R,5R)-3-[(2S,3R,4S,5R)-4,5-dihydroxy-3-methoxyoxan-2-yl]oxy-5-hydroxy-2-[(2R,6R)-2-methyl-3-methylidene-6-[(3S,4R,5S,6S,8S,9R,10S,13R,14S,15R,17R)-3,4,6,8,15-pentahydroxy-10,13-dimethyl-1,2,3,4,5,6,7,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]heptoxy]oxan-4-yl] hydrogen sulfate
| Internal ID | c363361b-1aa4-4327-b9e4-236aa098ca60 |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides |
| IUPAC Name | [(2R,3S,4R,5R)-3-[(2S,3R,4S,5R)-4,5-dihydroxy-3-methoxyoxan-2-yl]oxy-5-hydroxy-2-[(2R,6R)-2-methyl-3-methylidene-6-[(3S,4R,5S,6S,8S,9R,10S,13R,14S,15R,17R)-3,4,6,8,15-pentahydroxy-10,13-dimethyl-1,2,3,4,5,6,7,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]heptoxy]oxan-4-yl] hydrogen sulfate |
| SMILES (Canonical) | CC(CCC(=C)C(C)COC1C(C(C(CO1)O)OS(=O)(=O)O)OC2C(C(C(CO2)O)O)OC)C3CC(C4C3(CCC5C4(CC(C6C5(CCC(C6O)O)C)O)O)C)O |
| SMILES (Isomeric) | C[C@H](CCC(=C)[C@@H](C)CO[C@H]1[C@H]([C@@H]([C@@H](CO1)O)OS(=O)(=O)O)O[C@H]2[C@@H]([C@H]([C@@H](CO2)O)O)OC)[C@H]3C[C@H]([C@@H]4[C@@]3(CC[C@H]5[C@]4(C[C@@H]([C@@H]6[C@@]5(CC[C@@H]([C@@H]6O)O)C)O)O)C)O |
| InChI | InChI=1S/C39H66O17S/c1-18(20(3)15-52-35-33(31(26(44)17-53-35)56-57(48,49)50)55-36-32(51-6)30(46)25(43)16-54-36)7-8-19(2)21-13-23(41)34-37(21,4)12-10-27-38(5)11-9-22(40)29(45)28(38)24(42)14-39(27,34)47/h19-36,40-47H,1,7-17H2,2-6H3,(H,48,49,50)/t19-,20+,21-,22+,23-,24+,25-,26-,27-,28+,29+,30+,31-,32-,33+,34-,35-,36+,37-,38-,39+/m1/s1 |
| InChI Key | ZADHQGHCYVGCBA-KAKSMQPRSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C39H66O17S |
| Molecular Weight | 839.00 g/mol |
| Exact Mass | 838.40207181 g/mol |
| Topological Polar Surface Area (TPSA) | 280.00 Ų |
| XlogP | 0.40 |
| Atomic LogP (AlogP) | 0.04 |
| H-Bond Acceptor | 16 |
| H-Bond Donor | 9 |
| Rotatable Bonds | 13 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.7630 | 76.30% |
| Caco-2 | - | 0.8788 | 87.88% |
| Blood Brain Barrier | + | 0.5750 | 57.50% |
| Human oral bioavailability | - | 0.7143 | 71.43% |
| Subcellular localzation | Mitochondria | 0.4065 | 40.65% |
| OATP2B1 inhibitior | - | 0.8689 | 86.89% |
| OATP1B1 inhibitior | + | 0.8426 | 84.26% |
| OATP1B3 inhibitior | + | 0.9301 | 93.01% |
| MATE1 inhibitior | - | 0.9800 | 98.00% |
| OCT2 inhibitior | - | 0.8271 | 82.71% |
| BSEP inhibitior | + | 0.9311 | 93.11% |
| P-glycoprotein inhibitior | + | 0.7359 | 73.59% |
| P-glycoprotein substrate | + | 0.7231 | 72.31% |
| CYP3A4 substrate | + | 0.7496 | 74.96% |
| CYP2C9 substrate | - | 1.0000 | 100.00% |
| CYP2D6 substrate | - | 0.8603 | 86.03% |
| CYP3A4 inhibition | - | 0.8868 | 88.68% |
| CYP2C9 inhibition | - | 0.7565 | 75.65% |
| CYP2C19 inhibition | - | 0.7102 | 71.02% |
| CYP2D6 inhibition | - | 0.8715 | 87.15% |
| CYP1A2 inhibition | - | 0.7417 | 74.17% |
| CYP2C8 inhibition | + | 0.6475 | 64.75% |
| CYP inhibitory promiscuity | - | 0.9109 | 91.09% |
| UGT catelyzed | + | 0.6000 | 60.00% |
| Carcinogenicity (binary) | - | 0.5900 | 59.00% |
| Carcinogenicity (trinary) | Non-required | 0.5877 | 58.77% |
| Eye corrosion | - | 0.9787 | 97.87% |
| Eye irritation | - | 0.9099 | 90.99% |
| Skin irritation | - | 0.7582 | 75.82% |
| Skin corrosion | - | 0.9159 | 91.59% |
| Ames mutagenesis | - | 0.6378 | 63.78% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.7798 | 77.98% |
| Micronuclear | + | 0.5600 | 56.00% |
| Hepatotoxicity | - | 0.6226 | 62.26% |
| skin sensitisation | - | 0.8481 | 84.81% |
| Respiratory toxicity | + | 0.6667 | 66.67% |
| Reproductive toxicity | + | 0.9111 | 91.11% |
| Mitochondrial toxicity | + | 0.6125 | 61.25% |
| Nephrotoxicity | - | 0.8961 | 89.61% |
| Acute Oral Toxicity (c) | III | 0.5600 | 56.00% |
| Estrogen receptor binding | + | 0.8138 | 81.38% |
| Androgen receptor binding | + | 0.7313 | 73.13% |
| Thyroid receptor binding | - | 0.5639 | 56.39% |
| Glucocorticoid receptor binding | + | 0.6430 | 64.30% |
| Aromatase binding | + | 0.6301 | 63.01% |
| PPAR gamma | + | 0.7512 | 75.12% |
| Honey bee toxicity | - | 0.5903 | 59.03% |
| Biodegradation | - | 0.7000 | 70.00% |
| Crustacea aquatic toxicity | + | 0.5545 | 55.45% |
| Fish aquatic toxicity | + | 0.9866 | 98.66% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.91% | 83.82% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 99.73% | 97.25% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.12% | 96.09% |
| CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 96.23% | 85.31% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.28% | 94.45% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.41% | 91.11% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 93.87% | 96.77% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 93.70% | 97.14% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 93.00% | 95.93% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.78% | 98.95% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 92.72% | 82.69% |
| CHEMBL233 | P35372 | Mu opioid receptor | 92.07% | 97.93% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 91.81% | 95.89% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 91.38% | 96.61% |
| CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 91.32% | 96.25% |
| CHEMBL4302 | P08183 | P-glycoprotein 1 | 91.13% | 92.98% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.10% | 97.09% |
| CHEMBL2815 | P04629 | Nerve growth factor receptor Trk-A | 90.98% | 87.16% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 90.15% | 91.19% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.06% | 100.00% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 88.63% | 96.47% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 88.31% | 95.71% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 87.98% | 93.18% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 87.93% | 96.38% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 87.20% | 92.88% |
| CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR | 86.92% | 92.78% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 86.59% | 99.18% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 86.34% | 91.03% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 86.08% | 94.33% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 85.67% | 91.24% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 85.06% | 96.90% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 85.05% | 92.50% |
| CHEMBL1974 | P36888 | Tyrosine-protein kinase receptor FLT3 | 85.04% | 91.83% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.92% | 95.89% |
| CHEMBL211 | P08172 | Muscarinic acetylcholine receptor M2 | 83.92% | 94.97% |
| CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 83.40% | 97.28% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 83.40% | 98.75% |
| CHEMBL1871 | P10275 | Androgen Receptor | 82.86% | 96.43% |
| CHEMBL4835 | P00338 | L-lactate dehydrogenase A chain | 82.59% | 95.34% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 82.52% | 98.10% |
| CHEMBL5600 | P27448 | Serine/threonine-protein kinase c-TAK1 | 82.51% | 88.81% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 82.47% | 93.03% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 82.46% | 95.58% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 82.31% | 100.00% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.26% | 100.00% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 81.93% | 95.83% |
| CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 81.79% | 89.05% |
| CHEMBL204 | P00734 | Thrombin | 81.78% | 96.01% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 81.43% | 92.86% |
| CHEMBL2959 | Q08881 | Tyrosine-protein kinase ITK/TSK | 81.38% | 95.00% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 81.37% | 98.05% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.17% | 96.00% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 80.87% | 95.50% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.54% | 89.00% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 80.51% | 97.50% |
| CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 80.44% | 100.00% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.24% | 90.71% |
| CHEMBL301 | P24941 | Cyclin-dependent kinase 2 | 80.14% | 91.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163106819 |
| LOTUS | LTS0258026 |
| wikiData | Q105369808 |