[(1R,2R,3R,4S,6R,7S,9S,10S,11S,13S)-2,6-diacetyloxy-7,11-dihydroxy-5,5,9-trimethyl-14-methylidene-15-oxo-3-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] acetate
| Internal ID | b4fc0812-e3bd-43b0-b041-d60d58c70238 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Kaurane diterpenoids |
| IUPAC Name | [(1R,2R,3R,4S,6R,7S,9S,10S,11S,13S)-2,6-diacetyloxy-7,11-dihydroxy-5,5,9-trimethyl-14-methylidene-15-oxo-3-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] acetate |
| SMILES (Canonical) | CC(=O)OC1C2C(C(C(CC2(C3C(CC4CC3(C1OC(=O)C)C(=O)C4=C)O)C)O)OC(=O)C)(C)C |
| SMILES (Isomeric) | CC(=O)O[C@@H]1[C@H]2[C@@](C[C@@H]([C@@H](C2(C)C)OC(=O)C)O)([C@@H]3[C@H](C[C@@H]4C[C@@]3([C@H]1OC(=O)C)C(=O)C4=C)O)C |
| InChI | InChI=1S/C26H36O9/c1-11-15-8-16(30)19-25(7)10-17(31)22(34-13(3)28)24(5,6)20(25)18(33-12(2)27)23(35-14(4)29)26(19,9-15)21(11)32/h15-20,22-23,30-31H,1,8-10H2,2-7H3/t15-,16+,17+,18-,19+,20-,22+,23+,25+,26+/m1/s1 |
| InChI Key | OTGJHZVYFNKBOP-IUAOKVTQSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C26H36O9 |
| Molecular Weight | 492.60 g/mol |
| Exact Mass | 492.23593272 g/mol |
| Topological Polar Surface Area (TPSA) | 136.00 Ų |
| XlogP | 1.60 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.89% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.96% | 94.45% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.89% | 91.11% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 92.82% | 91.19% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.98% | 85.14% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.18% | 98.95% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 86.28% | 93.00% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 85.89% | 82.69% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.11% | 95.56% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.39% | 97.09% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 81.28% | 91.07% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.12% | 94.33% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 80.70% | 96.77% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.64% | 100.00% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 80.05% | 95.38% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Isodon angustifolius |
| PubChem | 10648835 |
| LOTUS | LTS0095571 |
| wikiData | Q105199622 |