(1R)-9,20,25-trimethoxy-30-methyl-7,23-dioxa-15,30-diazaheptacyclo[22.6.2.23,6.18,12.114,18.027,31.022,33]hexatriaconta-3(36),4,6(35),8,10,12(34),14,16,18,20,22(33),24,26,31-tetradecaen-21-ol
| Internal ID | b222d2da-4a29-4a5b-bfdd-f4e50e7a1c32 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Ethers > Diarylethers |
| IUPAC Name | (1R)-9,20,25-trimethoxy-30-methyl-7,23-dioxa-15,30-diazaheptacyclo[22.6.2.23,6.18,12.114,18.027,31.022,33]hexatriaconta-3(36),4,6(35),8,10,12(34),14,16,18,20,22(33),24,26,31-tetradecaen-21-ol |
| SMILES (Canonical) | CN1CCC2=CC(=C3C=C2C1CC4=CC=C(C=C4)OC5=C(C=CC(=C5)CC6=NC=CC7=CC(=C(C(=C67)O3)O)OC)OC)OC |
| SMILES (Isomeric) | CN1CCC2=CC(=C3C=C2[C@H]1CC4=CC=C(C=C4)OC5=C(C=CC(=C5)CC6=NC=CC7=CC(=C(C(=C67)O3)O)OC)OC)OC |
| InChI | InChI=1S/C36H34N2O6/c1-38-14-12-23-18-30(41-3)32-20-26(23)28(38)16-21-5-8-25(9-6-21)43-31-17-22(7-10-29(31)40-2)15-27-34-24(11-13-37-27)19-33(42-4)35(39)36(34)44-32/h5-11,13,17-20,28,39H,12,14-16H2,1-4H3/t28-/m1/s1 |
| InChI Key | ZSNFAESLVXWHLZ-MUUNZHRXSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C36H34N2O6 |
| Molecular Weight | 590.70 g/mol |
| Exact Mass | 590.24168681 g/mol |
| Topological Polar Surface Area (TPSA) | 82.50 Ų |
| XlogP | 6.60 |
| There are no found synonyms. |
![2D Structure of (1R)-9,20,25-trimethoxy-30-methyl-7,23-dioxa-15,30-diazaheptacyclo[22.6.2.23,6.18,12.114,18.027,31.022,33]hexatriaconta-3(36),4,6(35),8,10,12(34),14,16,18,20,22(33),24,26,31-tetradecaen-21-ol](https://plantaedb.com/storage/docs/compounds/2023/11/5947e0a0-8548-11ee-b138-b9964096ff1f.jpg "2D Structure of (1R)-9,20,25-trimethoxy-30-methyl-7,23-dioxa-15,30-diazaheptacyclo[22.6.2.23,6.18,12.114,18.027,31.022,33]hexatriaconta-3(36),4,6(35),8,10,12(34),14,16,18,20,22(33),24,26,31-tetradecaen-21-ol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.53% | 96.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.99% | 85.14% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 95.06% | 91.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.78% | 94.00% |
| CHEMBL2243 | O00519 | Anandamide amidohydrolase | 93.63% | 97.53% |
| CHEMBL5747 | Q92793 | CREB-binding protein | 93.33% | 95.12% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 92.63% | 95.78% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.45% | 91.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 91.06% | 91.49% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.05% | 86.33% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 89.46% | 93.10% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.78% | 89.00% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 88.63% | 91.03% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.41% | 99.17% |
| CHEMBL2535 | P11166 | Glucose transporter | 87.83% | 98.75% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 87.80% | 92.94% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 87.70% | 90.71% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 87.45% | 100.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 87.18% | 90.00% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 87.03% | 89.62% |
| CHEMBL2581 | P07339 | Cathepsin D | 86.80% | 98.95% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 86.59% | 82.38% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.47% | 94.45% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.42% | 95.89% |
| CHEMBL4895 | P30530 | Tyrosine-protein kinase receptor UFO | 86.06% | 90.95% |
| CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 84.86% | 96.39% |
| CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 84.49% | 89.05% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 84.48% | 93.99% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 84.24% | 95.62% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.90% | 92.62% |
| CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 83.38% | 96.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.11% | 99.23% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 82.23% | 97.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Caryomene olivascens |
| PubChem | 23259241 |
| LOTUS | LTS0178499 |
| wikiData | Q105382596 |