(4S,4aS,5R,6aR,6aS,6bR,8aR,10S,12aR,14bR)-10-[(2S,3R,4S,5S)-3-[(2S,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-4-hydroxy-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-4,5-dihydroxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carbaldehyde
Internal ID | 75e3e5c3-99d0-4e91-8d5e-382c0c46b1c9 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | (4S,4aS,5R,6aR,6aS,6bR,8aR,10S,12aR,14bR)-10-[(2S,3R,4S,5S)-3-[(2S,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-4-hydroxy-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-4,5-dihydroxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carbaldehyde |
SMILES (Canonical) | CC1(CC2C3=CCC4C5(CCC(C(C5CCC4(C3(CC(C2(C(C1)O)C=O)O)C)C)(C)C)OC6C(C(C(CO6)OC7C(C(C(C(O7)CO)O)O)O)O)OC8C(C(C(C(O8)CO)OC9C(C(C(C(O9)CO)O)O)O)O)O)C)C |
SMILES (Isomeric) | C[C@]12CC[C@@H](C([C@@H]1CC[C@@]3([C@@H]2CC=C4[C@]3(C[C@H]([C@@]5([C@@H]4CC(C[C@@H]5O)(C)C)C=O)O)C)C)(C)C)O[C@H]6[C@@H]([C@H]([C@H](CO6)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O)O)O)O)O[C@H]8[C@@H]([C@H]([C@@H]([C@H](O8)CO)O[C@H]9[C@@H]([C@H]([C@@H]([C@H](O9)CO)O)O)O)O)O |
InChI | InChI=1S/C53H86O23/c1-48(2)14-23-22-8-9-29-50(5)12-11-32(49(3,4)28(50)10-13-51(29,6)52(22,7)16-31(59)53(23,21-57)30(58)15-48)74-47-43(35(62)27(20-69-47)73-44-39(66)36(63)33(60)24(17-54)70-44)76-46-41(68)38(65)42(26(19-56)72-46)75-45-40(67)37(64)34(61)25(18-55)71-45/h8,21,23-47,54-56,58-68H,9-20H2,1-7H3/t23-,24-,25-,26-,27+,28+,29-,30+,31-,32+,33-,34-,35+,36+,37+,38-,39-,40-,41-,42-,43-,44+,45+,46+,47+,50+,51-,52-,53-/m1/s1 |
InChI Key | UFSPIXDWWJZKPR-QHSJPBSHSA-N |
Popularity | 0 references in papers |
Molecular Formula | C53H86O23 |
Molecular Weight | 1091.20 g/mol |
Exact Mass | 1090.55598899 g/mol |
Topological Polar Surface Area (TPSA) | 374.00 Ų |
XlogP | -1.20 |
There are no found synonyms. |
![2D Structure of (4S,4aS,5R,6aR,6aS,6bR,8aR,10S,12aR,14bR)-10-[(2S,3R,4S,5S)-3-[(2S,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-4-hydroxy-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-4,5-dihydroxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carbaldehyde 2D Structure of (4S,4aS,5R,6aR,6aS,6bR,8aR,10S,12aR,14bR)-10-[(2S,3R,4S,5S)-3-[(2S,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-4-hydroxy-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-4,5-dihydroxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carbaldehyde](https://plantaedb.com/storage/docs/compounds/2023/11/5945d330-8658-11ee-8a34-b5a95b4af1e3.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.69% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.40% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.71% | 95.56% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.13% | 100.00% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 87.68% | 90.17% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.34% | 97.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.22% | 95.89% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.13% | 94.45% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 85.41% | 97.36% |
CHEMBL2581 | P07339 | Cathepsin D | 84.40% | 98.95% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 83.52% | 96.21% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 83.21% | 93.00% |
CHEMBL5028 | O14672 | ADAM10 | 82.01% | 97.50% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 81.89% | 95.93% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 81.50% | 97.33% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 80.87% | 94.75% |
CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 80.71% | 90.24% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.08% | 94.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Lysimachia thyrsiflora |
PubChem | 162916943 |
LOTUS | LTS0183138 |
wikiData | Q105272085 |