(3S,6R)-6-[(1S,3R,6S,7S,8R,11S,12S,15R,16R)-6-hydroxy-7,12,16-trimethyl-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]-2-methylheptane-2,3-diol
Internal ID | 2235c107-ae1e-4471-8c40-24809a2e5d24 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Cycloartanols and derivatives |
IUPAC Name | (3S,6R)-6-[(1S,3R,6S,7S,8R,11S,12S,15R,16R)-6-hydroxy-7,12,16-trimethyl-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]-2-methylheptane-2,3-diol |
SMILES (Canonical) | CC1C2CCC3C4(CCC(C4(CCC35C2(C5)CCC1O)C)C(C)CCC(C(C)(C)O)O)C |
SMILES (Isomeric) | C[C@H]1[C@H]2CC[C@H]3[C@@]4(CC[C@@H]([C@]4(CC[C@@]35[C@@]2(C5)CC[C@@H]1O)C)[C@H](C)CC[C@@H](C(C)(C)O)O)C |
InChI | InChI=1S/C29H50O3/c1-18(7-10-24(31)25(3,4)32)20-11-13-27(6)23-9-8-21-19(2)22(30)12-14-28(21)17-29(23,28)16-15-26(20,27)5/h18-24,30-32H,7-17H2,1-6H3/t18-,19+,20-,21-,22+,23+,24+,26-,27+,28-,29+/m1/s1 |
InChI Key | PVLTYJRTESGVMY-CSGHZELJSA-N |
Popularity | 0 references in papers |
Molecular Formula | C29H50O3 |
Molecular Weight | 446.70 g/mol |
Exact Mass | 446.37599545 g/mol |
Topological Polar Surface Area (TPSA) | 60.70 Ų |
XlogP | 6.90 |
There are no found synonyms. |
![2D Structure of (3S,6R)-6-[(1S,3R,6S,7S,8R,11S,12S,15R,16R)-6-hydroxy-7,12,16-trimethyl-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]-2-methylheptane-2,3-diol 2D Structure of (3S,6R)-6-[(1S,3R,6S,7S,8R,11S,12S,15R,16R)-6-hydroxy-7,12,16-trimethyl-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]-2-methylheptane-2,3-diol](https://plantaedb.com/storage/docs/compounds/2023/11/593eeba0-8499-11ee-aba9-b5f9e2e1e11b.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 99.59% | 97.25% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 96.30% | 96.61% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.05% | 91.11% |
CHEMBL233 | P35372 | Mu opioid receptor | 94.07% | 97.93% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 93.76% | 97.79% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.40% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 91.66% | 98.95% |
CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 89.05% | 94.78% |
CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 88.91% | 100.00% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 87.34% | 100.00% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 85.64% | 95.58% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 85.07% | 94.75% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.82% | 97.09% |
CHEMBL2095194 | P08709 | Coagulation factor VII/tissue factor | 84.54% | 99.17% |
CHEMBL1741186 | P51449 | Nuclear receptor ROR-gamma | 84.32% | 99.17% |
CHEMBL3837 | P07711 | Cathepsin L | 83.69% | 96.61% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 83.44% | 90.17% |
CHEMBL4482 | O96013 | Serine/threonine-protein kinase PAK 4 | 83.43% | 95.42% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 83.09% | 100.00% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 82.52% | 93.56% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.47% | 100.00% |
CHEMBL1977 | P11473 | Vitamin D receptor | 82.24% | 99.43% |
CHEMBL2007625 | O75874 | Isocitrate dehydrogenase [NADP] cytoplasmic | 81.76% | 99.00% |
CHEMBL237 | P41145 | Kappa opioid receptor | 81.07% | 98.10% |
CHEMBL236 | P41143 | Delta opioid receptor | 80.78% | 99.35% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 80.57% | 98.75% |
CHEMBL284 | P27487 | Dipeptidyl peptidase IV | 80.53% | 95.69% |
CHEMBL5203 | P33316 | dUTP pyrophosphatase | 80.41% | 99.18% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 80.36% | 92.86% |
CHEMBL1902 | P62942 | FK506-binding protein 1A | 80.29% | 97.05% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Aglaia rubiginosa |
PubChem | 162871028 |
LOTUS | LTS0076368 |
wikiData | Q105215506 |