(15S)-11-hydroxy-19-methoxy-7,7-dimethyl-15-(2-methylprop-1-enyl)-2,8,16-trioxapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1(14),3(12),4(9),5,10,17(22),18,20-octaen-13-one
Internal ID | 2cde10a1-9c4b-41f6-b774-2c246e9e0172 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Pyranoflavonoids |
IUPAC Name | (15S)-11-hydroxy-19-methoxy-7,7-dimethyl-15-(2-methylprop-1-enyl)-2,8,16-trioxapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1(14),3(12),4(9),5,10,17(22),18,20-octaen-13-one |
SMILES (Canonical) | CC(=CC1C2=C(C3=C(O1)C=C(C=C3)OC)OC4=C(C2=O)C(=CC5=C4C=CC(O5)(C)C)O)C |
SMILES (Isomeric) | CC(=C[C@H]1C2=C(C3=C(O1)C=C(C=C3)OC)OC4=C(C2=O)C(=CC5=C4C=CC(O5)(C)C)O)C |
InChI | InChI=1S/C26H24O6/c1-13(2)10-20-22-23(28)21-17(27)12-19-16(8-9-26(3,4)32-19)24(21)31-25(22)15-7-6-14(29-5)11-18(15)30-20/h6-12,20,27H,1-5H3/t20-/m0/s1 |
InChI Key | MWXGNEFXTSBFQH-FQEVSTJZSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C26H24O6 |
Molecular Weight | 432.50 g/mol |
Exact Mass | 432.15728848 g/mol |
Topological Polar Surface Area (TPSA) | 74.20 Ų |
XlogP | 5.50 |
BDBM50291304 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.76% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 94.62% | 91.49% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.40% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.31% | 95.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.35% | 94.45% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.71% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 91.61% | 98.95% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.46% | 99.15% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.36% | 95.89% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.14% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.71% | 86.33% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 85.38% | 95.71% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.21% | 99.23% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 84.41% | 97.14% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.02% | 90.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.92% | 99.17% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 83.13% | 96.77% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.65% | 92.62% |
CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 82.61% | 85.30% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.92% | 91.19% |
CHEMBL3401 | O75469 | Pregnane X receptor | 81.47% | 94.73% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 80.69% | 91.07% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 80.46% | 94.42% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.38% | 92.94% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Artocarpus altilis |
PubChem | 145955505 |
LOTUS | LTS0182510 |
wikiData | Q105173840 |