(5,9,14-Trimethyl-15-oxapentacyclo[11.3.1.01,10.04,9.014,16]heptadecan-5-yl)methanol
| Internal ID | 2e77a59f-a030-41b9-a5ce-d24d8f5280e0 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Kaurane diterpenoids |
| IUPAC Name | (5,9,14-trimethyl-15-oxapentacyclo[11.3.1.01,10.04,9.014,16]heptadecan-5-yl)methanol |
| SMILES (Canonical) | CC1(CCCC2(C1CCC34C2CCC(C3)C5(C4O5)C)C)CO |
| SMILES (Isomeric) | CC1(CCCC2(C1CCC34C2CCC(C3)C5(C4O5)C)C)CO |
| InChI | InChI=1S/C20H32O2/c1-17(12-21)8-4-9-18(2)14(17)7-10-20-11-13(5-6-15(18)20)19(3)16(20)22-19/h13-16,21H,4-12H2,1-3H3 |
| InChI Key | YGFBAYGZACDVJQ-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.50 g/mol |
| Exact Mass | 304.240230259 g/mol |
| Topological Polar Surface Area (TPSA) | 32.80 Ų |
| XlogP | 4.40 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL237 | P41145 | Kappa opioid receptor | 93.24% | 98.10% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.15% | 96.09% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.85% | 97.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.50% | 91.11% |
| CHEMBL233 | P35372 | Mu opioid receptor | 88.57% | 97.93% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 88.43% | 95.38% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 88.07% | 95.50% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 87.89% | 97.25% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.40% | 95.89% |
| CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 84.75% | 98.46% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.61% | 94.45% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.22% | 100.00% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.00% | 92.62% |
| CHEMBL5600 | P27448 | Serine/threonine-protein kinase c-TAK1 | 82.98% | 88.81% |
| CHEMBL5555 | O00767 | Acyl-CoA desaturase | 81.91% | 97.50% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.72% | 92.94% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 80.91% | 93.04% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Plectranthus fruticosus |
| PubChem | 73814456 |
| LOTUS | LTS0132848 |
| wikiData | Q105348059 |