[(3S)-2-(2,5-diacetyloxy-3-methoxy-4-methylphenyl)-6-methylhepta-1,5-dien-3-yl] (Z)-2-methylbut-2-enoate
| Internal ID | 136e5e9d-47ed-4738-8e31-f5290233e3a8 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
| IUPAC Name | [(3S)-2-(2,5-diacetyloxy-3-methoxy-4-methylphenyl)-6-methylhepta-1,5-dien-3-yl] (Z)-2-methylbut-2-enoate |
| SMILES (Canonical) | CC=C(C)C(=O)OC(CC=C(C)C)C(=C)C1=CC(=C(C(=C1OC(=O)C)OC)C)OC(=O)C |
| SMILES (Isomeric) | C/C=C(/C)\C(=O)O[C@@H](CC=C(C)C)C(=C)C1=CC(=C(C(=C1OC(=O)C)OC)C)OC(=O)C |
| InChI | InChI=1S/C25H32O7/c1-10-15(4)25(28)32-21(12-11-14(2)3)16(5)20-13-22(30-18(7)26)17(6)23(29-9)24(20)31-19(8)27/h10-11,13,21H,5,12H2,1-4,6-9H3/b15-10-/t21-/m0/s1 |
| InChI Key | RSDWPZIMRVUUGS-SDQNTSPESA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C25H32O7 |
| Molecular Weight | 444.50 g/mol |
| Exact Mass | 444.21480336 g/mol |
| Topological Polar Surface Area (TPSA) | 88.10 Ų |
| XlogP | 5.70 |
| There are no found synonyms. |
![2D Structure of [(3S)-2-(2,5-diacetyloxy-3-methoxy-4-methylphenyl)-6-methylhepta-1,5-dien-3-yl] (Z)-2-methylbut-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/590925b0-87b1-11ee-b27d-c9385c0c4f9d.jpg "2D Structure of [(3S)-2-(2,5-diacetyloxy-3-methoxy-4-methylphenyl)-6-methylhepta-1,5-dien-3-yl] (Z)-2-methylbut-2-enoate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 94.69% | 97.21% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.61% | 94.45% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.26% | 99.17% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 91.81% | 96.95% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.46% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.42% | 91.11% |
| CHEMBL2535 | P11166 | Glucose transporter | 89.10% | 98.75% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.67% | 96.09% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 87.62% | 91.07% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.51% | 95.56% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.06% | 96.00% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.90% | 95.50% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.54% | 94.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.77% | 86.33% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 80.17% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Senecio rosmarinifolius |
| PubChem | 163195282 |
| LOTUS | LTS0068057 |
| wikiData | Q105244575 |