(5',9'-Dimethylspiro[oxirane-2,14'-tetracyclo[11.2.1.01,10.04,9]hexadecane]-5'-yl)methanol
| Internal ID | c8ae70be-ca6d-4aa1-aa72-51c375c0eb3e |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Kaurane diterpenoids |
| IUPAC Name | (5',9'-dimethylspiro[oxirane-2,14'-tetracyclo[11.2.1.01,10.04,9]hexadecane]-5'-yl)methanol |
| SMILES (Canonical) | CC1(CCCC2(C1CCC34C2CCC(C3)C5(C4)CO5)C)CO |
| SMILES (Isomeric) | CC1(CCCC2(C1CCC34C2CCC(C3)C5(C4)CO5)C)CO |
| InChI | InChI=1S/C20H32O2/c1-17(12-21)7-3-8-18(2)15(17)6-9-19-10-14(4-5-16(18)19)20(11-19)13-22-20/h14-16,21H,3-13H2,1-2H3 |
| InChI Key | GLWGNRVCQHGZKE-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.50 g/mol |
| Exact Mass | 304.240230259 g/mol |
| Topological Polar Surface Area (TPSA) | 32.80 Ų |
| XlogP | 4.50 |
| There are no found synonyms. |
![2D Structure of (5',9'-Dimethylspiro[oxirane-2,14'-tetracyclo[11.2.1.01,10.04,9]hexadecane]-5'-yl)methanol](https://plantaedb.com/storage/docs/compounds/2023/11/59-dimethylspirooxirane-214-tetracyclo11210110049hexadecane-5-ylmethanol.jpg "2D Structure of (5',9'-Dimethylspiro[oxirane-2,14'-tetracyclo[11.2.1.01,10.04,9]hexadecane]-5'-yl)methanol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.55% | 91.11% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.49% | 97.25% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 92.68% | 98.10% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.16% | 96.09% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 90.70% | 96.38% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.03% | 97.09% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 89.37% | 95.50% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 86.67% | 95.38% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.27% | 94.45% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 86.21% | 96.77% |
| CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 86.00% | 100.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.44% | 95.89% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.31% | 100.00% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.71% | 92.62% |
| CHEMBL5555 | O00767 | Acyl-CoA desaturase | 81.75% | 97.50% |
| CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 80.95% | 89.05% |
| CHEMBL3012 | Q13946 | Phosphodiesterase 7A | 80.88% | 99.29% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.68% | 92.94% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 80.54% | 82.69% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Baccharis minutiflora |
| PubChem | 162991125 |
| LOTUS | LTS0066723 |
| wikiData | Q105011366 |