5,9-dihydroxy-9-(hydroxymethyl)-2-methyl-8H-pyrano[2,3-g][1]benzoxepin-4-one
| Internal ID | 9f42e0bb-2a58-4b2a-9fa1-933c05c24545 |
| Taxonomy | Organoheterocyclic compounds > Benzoxepines |
| IUPAC Name | 5,9-dihydroxy-9-(hydroxymethyl)-2-methyl-8H-pyrano[2,3-g][1]benzoxepin-4-one |
| SMILES (Canonical) | CC1=CC(=O)C2=C(O1)C3=C(C=C2O)OCC(C=C3)(CO)O |
| SMILES (Isomeric) | CC1=CC(=O)C2=C(O1)C3=C(C=C2O)OCC(C=C3)(CO)O |
| InChI | InChI=1S/C15H14O6/c1-8-4-10(17)13-11(18)5-12-9(14(13)21-8)2-3-15(19,6-16)7-20-12/h2-5,16,18-19H,6-7H2,1H3 |
| InChI Key | OGUZXOYWHIKKNX-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H14O6 |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.07903816 g/mol |
| Topological Polar Surface Area (TPSA) | 96.20 Ų |
| XlogP | 0.90 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.70% | 91.11% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 98.43% | 89.63% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.94% | 94.45% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.63% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.12% | 95.56% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.50% | 89.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 90.15% | 94.73% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.11% | 94.00% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 87.78% | 96.77% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 87.08% | 94.80% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.09% | 86.33% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.15% | 99.23% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.80% | 100.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 81.28% | 90.00% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 80.34% | 93.99% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.01% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Eranthis cilicica |
| PubChem | 42603923 |
| LOTUS | LTS0118568 |
| wikiData | Q105191872 |