15-Hydroxy-4,6,12,17,17-pentamethyl-18-(3,4,5-trihydroxyoxan-2-yl)oxy-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-8-one
Internal ID | c391d627-a93b-46fd-9d51-06029252ae56 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | 15-hydroxy-4,6,12,17,17-pentamethyl-18-(3,4,5-trihydroxyoxan-2-yl)oxy-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-8-one |
SMILES (Canonical) | CC1CC(=O)OC2C1C3(CCC45CC46CCC(C(C6C(CC5C3(C2)C)O)(C)C)OC7C(C(C(CO7)O)O)O)C |
SMILES (Isomeric) | CC1CC(=O)OC2C1C3(CCC45CC46CCC(C(C6C(CC5C3(C2)C)O)(C)C)OC7C(C(C(CO7)O)O)O)C |
InChI | InChI=1S/C31H48O8/c1-15-10-21(34)38-18-12-29(5)19-11-16(32)25-27(2,3)20(39-26-24(36)23(35)17(33)13-37-26)6-7-31(25)14-30(19,31)9-8-28(29,4)22(15)18/h15-20,22-26,32-33,35-36H,6-14H2,1-5H3 |
InChI Key | QEXVYSIHQABYBB-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C31H48O8 |
Molecular Weight | 548.70 g/mol |
Exact Mass | 548.33491849 g/mol |
Topological Polar Surface Area (TPSA) | 126.00 Ų |
XlogP | 3.30 |
There are no found synonyms. |
![2D Structure of 15-Hydroxy-4,6,12,17,17-pentamethyl-18-(3,4,5-trihydroxyoxan-2-yl)oxy-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-8-one 2D Structure of 15-Hydroxy-4,6,12,17,17-pentamethyl-18-(3,4,5-trihydroxyoxan-2-yl)oxy-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-8-one](https://plantaedb.com/storage/docs/compounds/2023/11/58ef53a0-857a-11ee-abe2-3fad204289cf.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.55% | 91.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.27% | 97.25% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.00% | 97.09% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.80% | 96.09% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 91.23% | 92.94% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 90.91% | 82.69% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.76% | 95.56% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 89.62% | 96.77% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.66% | 100.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.33% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.20% | 89.00% |
CHEMBL1902 | P62942 | FK506-binding protein 1A | 84.21% | 97.05% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.77% | 95.89% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 83.63% | 97.14% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 82.00% | 85.14% |
CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 81.28% | 82.38% |
CHEMBL2581 | P07339 | Cathepsin D | 81.07% | 98.95% |
CHEMBL204 | P00734 | Thrombin | 80.96% | 96.01% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 80.78% | 92.88% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.76% | 91.19% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.34% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Astragalus multiceps |
PubChem | 162946447 |
LOTUS | LTS0125760 |
wikiData | Q104888888 |