[17-(1-Acetyloxyethyl)-3-[5-[5-[5-(3,5-dihydroxy-4-methoxy-6-methyloxan-2-yl)oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-8,14,17-trihydroxy-10,13-dimethyl-1,2,3,4,7,9,11,12,15,16-decahydrocyclopenta[a]phenanthren-12-yl] benzoate
Internal ID | 29d9a6dc-2561-4383-aa4e-b1518bce097d |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides |
IUPAC Name | [17-(1-acetyloxyethyl)-3-[5-[5-[5-(3,5-dihydroxy-4-methoxy-6-methyloxan-2-yl)oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-8,14,17-trihydroxy-10,13-dimethyl-1,2,3,4,7,9,11,12,15,16-decahydrocyclopenta[a]phenanthren-12-yl] benzoate |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(OC(CC2OC)OC3C(OC(CC3OC)OC4C(OC(CC4OC)OC5CCC6(C7CC(C8(C(CCC8(C7(CC=C6C5)O)O)(C(C)OC(=O)C)O)C)OC(=O)C9=CC=CC=C9)C)C)C)C)O)OC)O |
SMILES (Isomeric) | CC1C(C(C(C(O1)OC2C(OC(CC2OC)OC3C(OC(CC3OC)OC4C(OC(CC4OC)OC5CCC6(C7CC(C8(C(CCC8(C7(CC=C6C5)O)O)(C(C)OC(=O)C)O)C)OC(=O)C9=CC=CC=C9)C)C)C)C)O)OC)O |
InChI | InChI=1S/C58H88O21/c1-29-46(60)51(69-12)47(61)53(73-29)79-50-32(4)72-45(27-40(50)68-11)78-49-31(3)71-44(26-39(49)67-10)77-48-30(2)70-43(25-38(48)66-9)75-37-19-20-54(7)36(24-37)18-21-57(64)41(54)28-42(76-52(62)35-16-14-13-15-17-35)55(8)56(63,22-23-58(55,57)65)33(5)74-34(6)59/h13-18,29-33,37-51,53,60-61,63-65H,19-28H2,1-12H3 |
InChI Key | HBZQTDKRTCFXSV-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C58H88O21 |
Molecular Weight | 1121.30 g/mol |
Exact Mass | 1120.58180981 g/mol |
Topological Polar Surface Area (TPSA) | 265.00 Ų |
XlogP | 3.20 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 97.90% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.24% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.48% | 86.33% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.26% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.29% | 89.00% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 92.29% | 94.08% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 92.07% | 83.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.58% | 99.23% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.21% | 85.14% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 89.59% | 97.14% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.34% | 95.56% |
CHEMBL5028 | O14672 | ADAM10 | 89.21% | 97.50% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.92% | 95.89% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 88.71% | 95.89% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 86.97% | 91.49% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 86.53% | 100.00% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 86.52% | 91.07% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 85.89% | 95.93% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.15% | 100.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.05% | 96.00% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 83.96% | 94.62% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.45% | 91.19% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 83.38% | 100.00% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 83.34% | 95.50% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 82.99% | 95.71% |
CHEMBL264 | Q9Y5N1 | Histamine H3 receptor | 81.40% | 91.43% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.01% | 92.62% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 81.00% | 94.23% |
CHEMBL2782 | P35610 | Acyl coenzyme A:cholesterol acyltransferase 1 | 80.80% | 91.65% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.29% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Araujia sericifera |
PubChem | 85320566 |
LOTUS | LTS0103203 |
wikiData | Q105025557 |