(4S)-4-[(E)-2-[(1R,2S,5S,9R)-1,3,5,7-tetramethyl-9-(3-oxopent-1-en-2-yl)-2-bicyclo[3.3.1]nona-3,7-dienyl]prop-1-enyl]cyclopent-2-en-1-one
| Internal ID | 69df1b67-c046-4f23-b6e1-5b39dccf1db1 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
| IUPAC Name | (4S)-4-[(E)-2-[(1R,2S,5S,9R)-1,3,5,7-tetramethyl-9-(3-oxopent-1-en-2-yl)-2-bicyclo[3.3.1]nona-3,7-dienyl]prop-1-enyl]cyclopent-2-en-1-one |
| SMILES (Canonical) | CCC(=O)C(=C)C1C2(CC(=CC1(C(C(=C2)C)C(=CC3CC(=O)C=C3)C)C)C)C |
| SMILES (Isomeric) | CCC(=O)C(=C)[C@@H]1[C@]2(CC(=C[C@@]1([C@H](C(=C2)C)/C(=C/[C@H]3CC(=O)C=C3)/C)C)C)C |
| InChI | InChI=1S/C26H34O2/c1-8-22(28)19(5)24-25(6)13-16(2)14-26(24,7)23(18(4)15-25)17(3)11-20-9-10-21(27)12-20/h9-11,14-15,20,23-24H,5,8,12-13H2,1-4,6-7H3/b17-11+/t20-,23-,24+,25-,26+/m0/s1 |
| InChI Key | FMKMRACZTYQJQI-LHZVXGHXSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C26H34O2 |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.255880323 g/mol |
| Topological Polar Surface Area (TPSA) | 34.10 Ų |
| XlogP | 5.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.32% | 91.11% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 95.22% | 96.95% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 94.54% | 97.21% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.42% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.29% | 98.95% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.11% | 97.25% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.27% | 95.56% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 87.97% | 94.80% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 86.70% | 90.17% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.00% | 86.33% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.63% | 100.00% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 84.45% | 89.34% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.66% | 89.00% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.14% | 91.19% |
| CHEMBL1902 | P62942 | FK506-binding protein 1A | 81.82% | 97.05% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.63% | 92.94% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Leucanthemella serotina |
| PubChem | 102597354 |
| LOTUS | LTS0220234 |
| wikiData | Q105124220 |