5,8,11,14-Eicosatetraynoic Acid
| Internal ID | 83c01f4b-1dda-495d-bdbc-af0adef4d31e |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty acids and conjugates > Long-chain fatty acids |
| IUPAC Name | icosa-5,8,11,14-tetraynoic acid |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C20H24O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h2-5,8,11,14,17-19H2,1H3,(H,21,22) |
| InChI Key | MGLDCXPLYOWQRP-UHFFFAOYSA-N |
| Popularity | 933 references in papers |
| Molecular Formula | C20H24O2 |
| Molecular Weight | 296.40 g/mol |
| Exact Mass | 296.177630004 g/mol |
| Topological Polar Surface Area (TPSA) | 37.30 Ų |
| XlogP | 5.30 |
| Atomic LogP (AlogP) | 4.01 |
| H-Bond Acceptor | 1 |
| H-Bond Donor | 1 |
| Rotatable Bonds | 6 |
| ETYA |
| 1191-85-1 |
| Ro 3-1428 |
| 5FEJ8J06DR |
| Ro 31428 |
| DTXSID20152318 |
| 5,8,11,14 Eicosatetraynoic Acid |
| Ro 3 1428 |
| RefChem:388757 |
| DTXCID4074809 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.9919 | 99.19% |
| Caco-2 | - | 0.6438 | 64.38% |
| Blood Brain Barrier | + | 0.8250 | 82.50% |
| Human oral bioavailability | - | 0.5143 | 51.43% |
| Subcellular localzation | Mitochondria | 0.5160 | 51.60% |
| OATP2B1 inhibitior | - | 0.8542 | 85.42% |
| OATP1B1 inhibitior | + | 0.8201 | 82.01% |
| OATP1B3 inhibitior | - | 0.3106 | 31.06% |
| MATE1 inhibitior | - | 0.9000 | 90.00% |
| OCT2 inhibitior | - | 0.9250 | 92.50% |
| BSEP inhibitior | - | 0.7271 | 72.71% |
| P-glycoprotein inhibitior | - | 0.8209 | 82.09% |
| P-glycoprotein substrate | - | 0.9205 | 92.05% |
| CYP3A4 substrate | - | 0.6561 | 65.61% |
| CYP2C9 substrate | + | 0.6464 | 64.64% |
| CYP2D6 substrate | - | 0.8866 | 88.66% |
| CYP3A4 inhibition | - | 0.8850 | 88.50% |
| CYP2C9 inhibition | - | 0.7810 | 78.10% |
| CYP2C19 inhibition | - | 0.9259 | 92.59% |
| CYP2D6 inhibition | - | 0.9478 | 94.78% |
| CYP1A2 inhibition | + | 0.8724 | 87.24% |
| CYP2C8 inhibition | - | 0.8825 | 88.25% |
| CYP inhibitory promiscuity | - | 0.9358 | 93.58% |
| UGT catelyzed | - | 0.0000 | 0.00% |
| Carcinogenicity (binary) | - | 0.6735 | 67.35% |
| Carcinogenicity (trinary) | Non-required | 0.6833 | 68.33% |
| Eye corrosion | + | 0.9569 | 95.69% |
| Eye irritation | + | 0.7251 | 72.51% |
| Skin irritation | + | 0.7144 | 71.44% |
| Skin corrosion | + | 0.7890 | 78.90% |
| Ames mutagenesis | - | 0.9200 | 92.00% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.6515 | 65.15% |
| Micronuclear | - | 0.9600 | 96.00% |
| Hepatotoxicity | + | 0.6324 | 63.24% |
| skin sensitisation | + | 0.8452 | 84.52% |
| Respiratory toxicity | - | 0.6556 | 65.56% |
| Reproductive toxicity | - | 0.6998 | 69.98% |
| Mitochondrial toxicity | + | 0.5500 | 55.00% |
| Nephrotoxicity | + | 0.5162 | 51.62% |
| Acute Oral Toxicity (c) | IV | 0.4480 | 44.80% |
| Estrogen receptor binding | - | 0.5187 | 51.87% |
| Androgen receptor binding | - | 0.7119 | 71.19% |
| Thyroid receptor binding | + | 0.6740 | 67.40% |
| Glucocorticoid receptor binding | - | 0.5286 | 52.86% |
| Aromatase binding | - | 0.6955 | 69.55% |
| PPAR gamma | + | 0.6115 | 61.15% |
| Honey bee toxicity | - | 0.9886 | 98.86% |
| Biodegradation | - | 0.6750 | 67.50% |
| Crustacea aquatic toxicity | + | 0.5277 | 52.77% |
| Fish aquatic toxicity | + | 0.9420 | 94.20% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] |
28183.8 nM |
Potency |
via CMAUP
|
| CHEMBL3577 | P00352 | Aldehyde dehydrogenase 1A1 |
35481.3 nM |
Potency |
via CMAUP
|
| CHEMBL3687 | P18054 | Arachidonate 12-lipoxygenase |
3162.3 nM |
Potency |
via CMAUP
|
| CHEMBL1293236 | P46063 | ATP-dependent DNA helicase Q1 |
28183.8 nM 1122 nM |
Potency Potency |
via CMAUP
via CMAUP |
| CHEMBL1293237 | P54132 | Bloom syndrome protein |
12589.3 nM |
Potency |
via CMAUP
|
| CHEMBL2392 | P06746 | DNA polymerase beta |
1122 nM |
Potency |
via CMAUP
|
| CHEMBL4361 | Q07820 | Induced myeloid leukemia cell differentiation protein Mcl-1 |
441.49 nM 441.49 nM |
IC50 IC50 |
via CMAUP
via Super-PRED |
| CHEMBL1293226 | B2RXH2 | Lysine-specific demethylase 4D-like |
15848.9 nM |
Potency |
via CMAUP
|
| CHEMBL1293224 | P10636 | Microtubule-associated protein tau |
19952.6 nM 28183.8 nM |
Potency Potency |
via CMAUP
via CMAUP |
| CHEMBL1293232 | Q16637 | Survival motor neuron protein |
12589.3 nM |
Potency |
via CMAUP
|
| CHEMBL1075138 | Q9NUW8 | Tyrosyl-DNA phosphodiesterase 1 |
10000 nM 631 nM |
Potency Potency |
via CMAUP
via CMAUP |
| CHEMBL1293227 | O75604 | Ubiquitin carboxyl-terminal hydrolase 2 |
28183.8 nM |
Potency |
via CMAUP
|
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 95.27% | 98.95% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 94.83% | 90.17% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.49% | 96.09% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 93.33% | 89.63% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.45% | 99.17% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 86.98% | 92.08% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 86.24% | 97.00% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.85% | 96.95% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 80.06% | 93.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Citrus × aurantium |
| Citrus × aurantium nothof. deliciosa |
| PubChem | 1780 |
| NPASS | NPC158179 |
| ChEMBL | CHEMBL458328 |