5,8-Dihydroxy-3-(4-hydroxybenzyl)-7-methoxy-4-chromanone 8-acetate
Internal ID | 098991be-02a2-4f57-b7e0-3bbcf581dd01 |
Taxonomy | Phenylpropanoids and polyketides > Homoisoflavonoids > Homoisoflavans > Homoisoflavanones |
IUPAC Name | [5-hydroxy-3-[(4-hydroxyphenyl)methyl]-7-methoxy-4-oxo-2,3-dihydrochromen-8-yl] acetate |
SMILES (Canonical) | CC(=O)OC1=C(C=C(C2=C1OCC(C2=O)CC3=CC=C(C=C3)O)O)OC |
SMILES (Isomeric) | CC(=O)OC1=C(C=C(C2=C1OCC(C2=O)CC3=CC=C(C=C3)O)O)OC |
InChI | InChI=1S/C19H18O7/c1-10(20)26-18-15(24-2)8-14(22)16-17(23)12(9-25-19(16)18)7-11-3-5-13(21)6-4-11/h3-6,8,12,21-22H,7,9H2,1-2H3 |
InChI Key | NXGGYXKVAVMQLL-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C19H18O7 |
Molecular Weight | 358.30 g/mol |
Exact Mass | 358.10525291 g/mol |
Topological Polar Surface Area (TPSA) | 102.00 Ų |
XlogP | 2.90 |
CHEBI:168807 |
DTXSID801114060 |
[5-hydroxy-3-[(4-hydroxyphenyl)methyl]-7-methoxy-4-oxo-2,3-dihydrochromen-8-yl] acetate |
(-)-8-(Acetyloxy)-2,3-dihydro-5-hydroxy-3-[(4-hydroxyphenyl)methyl]-7-methoxy-4H-1-benzopyran-4-one |
5-hydroxy-3-[(4-hydroxyphenyl)methyl]-7-methoxy-4-oxo-3,4-dihydro-2H-1-benzopyran-8-yl acetate |
99877-75-5 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.96% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.57% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.18% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 95.88% | 98.95% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.74% | 99.17% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.96% | 94.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.13% | 85.14% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.38% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.31% | 95.56% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 88.96% | 95.89% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.47% | 89.00% |
CHEMBL2535 | P11166 | Glucose transporter | 86.38% | 98.75% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.81% | 95.89% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 85.66% | 95.50% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.78% | 92.62% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 83.17% | 97.28% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.50% | 97.09% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.35% | 91.19% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.91% | 97.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Leopoldia comosa |
PubChem | 21627907 |
LOTUS | LTS0029897 |
wikiData | Q105187167 |