(1S,9S)-13-hydroxy-14,14,16,16-tetramethyl-2,17-dioxatetracyclo[7.7.1.01,12.03,8]heptadeca-3,5,7,12-tetraene-11,15-dione
| Internal ID | 21abc071-1f29-4296-a620-f7dc9c051e4c |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Ethers > Acetals > Ketals |
| IUPAC Name | (1S,9S)-13-hydroxy-14,14,16,16-tetramethyl-2,17-dioxatetracyclo[7.7.1.01,12.03,8]heptadeca-3,5,7,12-tetraene-11,15-dione |
| SMILES (Canonical) | CC1(C(=C2C(=O)CC3C4=CC=CC=C4OC2(O3)C(C1=O)(C)C)O)C |
| SMILES (Isomeric) | CC1(C(=C2C(=O)C[C@H]3C4=CC=CC=C4O[C@@]2(O3)C(C1=O)(C)C)O)C |
| InChI | InChI=1S/C19H20O5/c1-17(2)15(21)14-11(20)9-13-10-7-5-6-8-12(10)23-19(14,24-13)18(3,4)16(17)22/h5-8,13,21H,9H2,1-4H3/t13-,19-/m0/s1 |
| InChI Key | XZEWTFGHFZJQDU-DJJJIMSYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H20O5 |
| Molecular Weight | 328.40 g/mol |
| Exact Mass | 328.13107373 g/mol |
| Topological Polar Surface Area (TPSA) | 72.80 Ų |
| XlogP | 2.40 |
| There are no found synonyms. |
![2D Structure of (1S,9S)-13-hydroxy-14,14,16,16-tetramethyl-2,17-dioxatetracyclo[7.7.1.01,12.03,8]heptadeca-3,5,7,12-tetraene-11,15-dione](https://plantaedb.com/storage/docs/compounds/2023/11/57ba6fa0-85bc-11ee-9226-876bf774de69.jpg "2D Structure of (1S,9S)-13-hydroxy-14,14,16,16-tetramethyl-2,17-dioxatetracyclo[7.7.1.01,12.03,8]heptadeca-3,5,7,12-tetraene-11,15-dione")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.06% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.48% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.42% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.85% | 96.09% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 89.59% | 99.23% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 89.01% | 83.82% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.46% | 89.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 88.38% | 85.14% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.81% | 97.09% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 84.40% | 100.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.80% | 94.45% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 82.81% | 85.11% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 80.86% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Uvaria afzelii |
| PubChem | 162864451 |
| LOTUS | LTS0065307 |
| wikiData | Q105344883 |